{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = | Watchedfields = | verifiedrevid = | IUPAC_name = (7''R'',8''R'',9''S'',10''R'',13''S'',14''S'')-7,13-Dimethyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[''a'']phenanthrene-3,17-dione | image = 7α-Methyl-19-norandrostenedione.svg | image_class = skin-invert-image | width = 200px
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Oral<ref name="pmid25684733" />
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number_Ref = | CAS_number = 17000-78-1 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 53916207 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 31046848 | UNII = 25W4OLA785 | KEGG = | ChEBI = | ChEMBL =
<!--Chemical data--> | C=19 | H=26 | O=2 | molecular_weight = | SMILES = C[C@@H]1CC2=CC(=O)CC[C@@H]2[C@@H]3[C@@H]1[C@@H]4CCC(=O)[C@]4(CC3)C | StdInChI_Ref = | StdInChI = 1S/C19H26O2/c1-11-9-12-10-13(20)3-4-14(12)15-7-8-19(2)16(18(11)15)5-6-17(19)21/h10-11,14-16,18H,3-9H2,1-2H3/t11-,14+,15-,16+,18-,19+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = IHFREKJAIFEZMQ-ARTWWJDJSA-N | synonyms = 7α-Methyl-19-norandrost-4-ene-3,17-dione; 7α-Methylestr-4-ene-3,17-dione; MENT dione; Trestione; Mentabolan }}
'''7α-Methyl-19-norandrostenedione''' ('''MENT dione'''), or '''7α-methyl-19-norandrost-4-ene-3,17-dione''', also known as '''trestione''', as well as '''7α-methylestr-4-ene-3,17-dione''', is a synthetic anabolic-androgenic steroid (AAS) and a derivative of 19-nortestosterone (nandrolone).<ref name="pmid25684733">{{cite journal | vauthors = Rahnema CD, Crosnoe LE, Kim ED | title = Designer steroids - over-the-counter supplements and their androgenic component: review of an increasing problem | journal = Andrology | volume = 3 | issue = 2 | pages = 150–5 | year = 2015 | pmid = 25684733 | doi = 10.1111/andr.307 | s2cid = 6999218 | doi-access = free }}</ref><ref name="NaYum2012">Na, S., Yum, T., Choi, H., Jung, H., Pang, K., & Kim, Y. (2012). Detection of metabolites of mentabolan, a pro-anabolic steroid never marketed, in human urine by GC/MS and GC/MS/MS analysis. 제 49 회 한국분석과학회 추계학술대회, 229-229.</ref> It may act as a prohormone of trestolone (7α-methyl-19-nortestosterone; MENT).<ref name="pmid25684733" /><ref name="NaYum2012" /> MENT dione has been sold on the Internet under the name '''Mentabolan''' as a "dietary supplement".<ref name="pmid25684733" /><ref name="NaYum2012" />
==Applications== #If mentabolan is oxidized with a catalytic amount of a copper halide in the presence of oxygen it gives almestrone.<ref>Kuniaki Tatsuta, Kazuo Maruhashi, & Shingo Yano, WO2007049672 (to Taiho Pharmaceutical Co Ltd).</ref> #Mentabolan is a precursor in a recent Chinese synthesis of tibolone.<ref>孙晓明, et al. CN114409717 (2023 to Hunan Keyixin Biomedical Co ltd).</ref> #Mentabolan was an intermediate in the original Upjohn synthesis of mibolerone. ==See also== * 4-Androstenedione * Bolandiol * Bolandione * Bolenol * Dienedione * Methoxydienone
==References== {{Reflist}}
{{Androgen receptor modulators}}
{{DEFAULTSORT:Methyl-19-norandrostenedione, 7α-}}
Category:Androgens Category:Diketones Category:Estranes Category:Androgen esters {{Androgen-stub}} {{Estrane-stub}} {{genito-urinary-drug-stub}}