{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 472254319 | ImageFile = mangostin structure.png | ImageSize = | PIN = 1,3,6-Trihydroxy-7-methoxy-2,8-bis(3-methylbut-2-en-1-yl)-9''H''-xanthen-9-one | OtherNames = alpha-mangostin |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 6147-11-1 | UNII_Ref = {{fdacite|changed|FDA}} | UNII = U6RIV93RU1 | PubChem = 5281650 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 67547 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 323197 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4444969 | InChI = 1/C24H26O6/c1-12(2)6-8-14-16(25)10-19-21(22(14)27)23(28)20-15(9-7-13(3)4)24(29-5)17(26)11-18(20)30-19/h6-7,10-11,25-27H,8-9H2,1-5H3 | InChIKey = GNRIZKKCNOBBMO-UHFFFAOYAL | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C24H26O6/c1-12(2)6-8-14-16(25)10-19-21(22(14)27)23(28)20-15(9-7-13(3)4)24(29-5)17(26)11-18(20)30-19/h6-7,10-11,25-27H,8-9H2,1-5H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = GNRIZKKCNOBBMO-UHFFFAOYSA-N | SMILES = CC(=CCC1=C(C=C2C(=C1O)C(=O)C3=C(C(=C(C=C3O2)O)OC)CC=C(C)C)O)C }} |Section2={{Chembox Properties | C=24 | H=26 | O=6 | Appearance = Yellow crystalline solid | Density = 1.265 g/ml | MeltingPtC = 182 | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Mangostin''' is a natural xanthonoid, a type of organic compound isolated from various parts of the mangosteen tree (''Garcinia mangostana''). It is a yellow crystalline solid with a xanthone core structure.
==Source== The rind of partially ripe mangosteen fruit yields mangostin and also the related compound β-mangostin. Researchers conducted optimizations to increase the yield of α-mangostin extraction from the pericarp of the mangosteen and were able to achieve 9.2 g/kg DW.<ref>{{Cite journal| issue=1|doi=10.36877/pddbs.a0000072|title=A Rapid Method for the Retrieval of Bioactive Xanthone from Garcinia Mangostana: A Case Study of α-Mangostin|year=2020|last1=Khaw|first1=Kooi Yeong|last2=Ong|first2=Yong Sze|last3=Goh|first3=Bey-Hing|journal=Progress in Drug Discovery & Biomedical Science|volume=3|doi-access=free}}</ref> The rind of fully ripe fruits also contains the xanthonoids gartanin, 8-disoxygartanin, and normangostin.{{cn|date=August 2017}}
==Research== Mangostin and a variety of other xanthonoids from mangosteen have been investigated for biological properties including antioxidant, anti-bacterial, anti-inflammatory, and anticancer activities.<ref>{{cite journal |vauthors=Jung H, Su B, Keller W, Mehta R, Kinghorn A |title=Antioxidant xanthones from the pericarp of Garcinia mangostana (Mangosteen) |journal=J. Agric. Food Chem. |volume=54 |issue=6 |pages=2077–82 |year=2006 |pmid=16536578 |doi=10.1021/jf052649z}}</ref>
In animal studies, mangostin has been found to be a central nervous system depressant which causes sedation, decreased motor activity, and ptosis.<ref>{{cite journal | journal=Arch Int Pharmacodyn Ther. |year=1979 |volume=239 | issue=2 |pages=257–269 |title=Pharmacological profile of mangostin and its derivatives |vauthors=Shankaranarayan D, Gopalakrishnan C, Kameswaran L |pmid=314790}}</ref>{{better source|date=August 2017}}
==Related compounds== A derivative of mangostin, mangostin-3,6-di-O-glucoside, is a central nervous system depressant and causes a rise in blood pressure.{{cn|date=August 2017}}
== References == {{Reflist}}
{{xanthonoid}}
Category:Xanthonoids Category:Dietary antioxidants