{{DISPLAYTITLE:''m''-Cymene}} {{short description|Organic compound}} {{Chembox | Name = ''m''-Cymene <!-- Images --> | ImageFile = M-Cymol.svg | ImageSize = 160px | ImageAlt = <!-- Names --> | PIN = 1-Methyl-3-(propan-2-yl)benzene | OtherNames = {{Unbulleted list | ''m''-Cymene | 3-isopropyltoluene | 3-methylcumene | 1-isopropyl-3-methylbenzene }} <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 535-77-3 | ChemSpiderID = 10355 | PubChem = 10812 | ChEBI = 28768 | EC_number = 208-617-9 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 10ZH8R921S | InChI = InChI=1S/C10H14/c1-8(2)10-6-4-5-9(3)7-10/h4-8H,1-3H3 | InChIKey = XCYJPXQACVEIOS-UHFFFAOYSA-N | SMILES = CC1=CC(=CC=C1)C(C)C }} | Section2 = {{Chembox Properties | Formula = C<sub>10</sub>H<sub>14</sub> | MolarMass = 134.22 | Appearance = colorless liquid | Density = 0.86 g/cm<sup>3</sup> | MeltingPtC = -63.8 | MeltingPt_ref = | BoilingPtC = 175 | BoilingPt_ref = | Solubility = 42.5 mg/L }} | Section3 = {{Chembox Hazards | GHSPictograms = {{GHS02}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|226}} | PPhrases = {{P-phrases|210|233|240|241|242|243|280|303+361+353|370+378|403+235|501}} | MainHazards = Flammable | FlashPtC = 47.8 | FlashPt_ref = | AutoignitionPtC = }} }}
'''''m''-Cymene''' is an organic compound classified as an aromatic hydrocarbon. Its structure consists of a benzene ring ''meta''-substituted with a methyl group and an isopropyl group. It is a flammable colorless liquid which is nearly insoluble in water but soluble in organic solvents.
== Isomers and production == In addition to ''m''-cymene, there are two other geometric isomers called ''o''-cymene, in which the alkyl groups are ''ortho''-substituted, and ''p''-cymene, in which they are ''para''-substituted. ''p''-Cymene is the most common and only natural isomer. The three isomers form the group of cymenes.
Cymenes can be produced by alkylation of toluene with propylene.<ref>{{cite encyclopedia|chapter=Alkylation|first1=Bipin V.|title=Kirk-Othmer Encyclopedia of Chemical Technology|last1=Vora|first2=Joseph A.|last2=Kocal|first3=Paul T.|last3=Barger|first4=Robert J.|last4=Schmidt|first5=James A.|last5=Johnson|year=2003|encyclopedia=Kirk‐Othmer Encyclopedia of Chemical Technology|doi=10.1002/0471238961.0112112508011313.a01.pub2|isbn=0471238961}}</ref><ref name=Ullmanns>{{Ullmann|first1 = Karl|last1 = Griesbaum|first2 = Arno|last2 = Behr|first3 = Dieter|last3 = Biedenkapp|first4 = Heinz-Werner|last4 = Voges|first5 = Dorothea|last5 = Garbe|first6 = Christian|last6 = Paetz|first7 = Gerd|last7 = Collin|first8 = Dieter|last8 = Mayer|first9 = Hartmut|last9 = Höke|title = Hydrocarbons|year = 2002|doi = 10.1002/14356007.a13_227}}</ref>
==References== <references/>
{{DEFAULTSORT:Cymene, m-}} Category:Alkylbenzenes Category:C4-Benzenes {{hydrocarbon-stub}} {{Hydrocarbons}}