{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 462094340 | ImageFile = Lufenuron 200.svg | ImageSize = | ImageFile2 = Lufenuron-3D-balls.png | ImageSize2 = | IUPACName = 1-[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-(2,6-difluorobenzoyl)urea | OtherNames = ''N''-<nowiki>[[[</nowiki>2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide<br />Fluphenacur<br />U.S. EPA PC Code: 118205 |Section1={{Chembox Identifiers | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 1R754M4918 | Abbreviations = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 64813 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1364906 | InChI = 1/C17H8Cl2F8N2O3/c18-6-5-11(32-17(26,27)14(22)16(23,24)25)7(19)4-10(6)28-15(31)29-13(30)12-8(20)2-1-3-9(12)21/h1-5,14H,(H2,28,29,30,31) | InChIKey = PWPJGUXAGUPAHP-UHFFFAOYAQ | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C17H8Cl2F8N2O3/c18-6-5-11(32-17(26,27)14(22)16(23,24)25)7(19)4-10(6)28-15(31)29-13(30)12-8(20)2-1-3-9(12)21/h1-5,14H,(H2,28,29,30,31) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = PWPJGUXAGUPAHP-UHFFFAOYSA-N | CASNo_Ref = {{cascite|changed|??}} | CASNo = 103055-07-8 | EINECS = | PubChem = 71777 | SMILES = Clc1cc(c(Cl)cc1OC(F)(F)C(F)C(F)(F)F)NC(=O)NC(=O)c2c(F)cccc2F | RTECS = | MeSHName = | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 39384 | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = D08150 }} |Section2={{Chembox Properties | C=17 | H=8 | Cl=2 | F=8 | N=2 | O=3 | Appearance = | Density = | MeltingPtC = 174 | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = | SolubleOther = | Solvent = | pKa = | pKb = }} |Section6={{Chembox Pharmacology | ATCvet = yes | ATCCode_prefix = P53 | ATCCode_suffix = BC01 }} |Section7={{Chembox Hazards | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | PEL = }} }}

'''Lufenuron''' is a chemical with insecticidal properties, belonging to the class of insecticides called insect growth regulators. It is a chitin synthesis inhibitor belonging to the benzoylurea class (IRAC group 15).

==Applications==

===Veterinary===

Lufenuron is one of the two active ingredients in the flea, heartworm, and anthelmintic medicine milbemycin oxime/lufenuron (Sentinel). It was also the active ingredient in the previously-marketed veterinary flea control medication Program.

Lufenuron is stored in the animal's body fat and transferred to adult fleas through the host's blood when they feed. Adult fleas transfer it to their growing eggs through their blood, and to hatched larvae feeding on their excrement. It does not kill adult fleas.{{citation needed|date=April 2016}}

Lufenuron inhibits the production of chitin in insects. Without chitin, a larval flea will never develop a hard outer shell (exoskeleton). With its inner organs exposed to air, the insect dies from dehydration soon after hatching or molting (shedding its old, smaller shell).{{citation needed|date=April 2016}}

Lufenuron is also used to fight fungal infections, since fungus cell walls are about one third chitin.<ref>{{cite journal |last1=Ben-Ziony |first1=Yair |last2=Arzi |first2=Boaz |title=Use of lufenuron for treating fungal infections of dogs and cats: 297 cases (1997-1999) |journal=Journal of the American Veterinary Medical Association |volume=217 |issue=10 |pages=1510–3 |year=2000 |pmid=11128542 |doi=10.2460/javma.2000.217.1510 }}</ref>

===Agriculture===

Lufenuron is also sold as an agricultural pesticide for use against lepidopterans, eriophyid mites, and western flower thrips. It is an effective antifungal in plants.<ref>{{cite book |title=The Pesticide Encyclopedia |author1=Paranjape, Kalyani |author2=Gowariker, Vasant |author3=Krishnamurthy, V N |ISBN=978-1-78064-014-3 |publisher=CABI |location=Wallingford, Oxfordshire UK Boston, MA |year=2014 |page=283 |url=https://books.google.com/books?id=cnDHBgAAQBAJ&pg=PA283 |quote=Lufenuron, a chitin synthesis inhibitor, is an effective agent against lepidopteran members in crops, eriophid mites and western flower thrips. In non-crop situations too, lufenuron is effective against fleas on animals and on cockroaches in households. This chemical also acts as an anti-fungal agent in plants. ... According to the WHO, lufenuron is a Class III toxin (slightly hazardous). It is safe on mammals, since it is not broken down by the liver or kidneys. |access-date=Nov 22, 2018 }}</ref>

== References == {{reflist}}

==External links== * {{PPDB|420}}

{{Insecticides}}

Category:Veterinary drugs Category:Insecticides Category:Acylureas Category:Antifungals Category:Chloroarenes Category:Organofluorides Category:Phenol ethers Category:Benzamides Category:Dog medications Category:Fungicides Category:Fluoroarenes Category:Trifluoromethyl compounds