{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | verifiedrevid = 447815293 | IUPAC_name = (1''S'',5''S'')-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one | image = Levoverbenone.svg | image_class = skin-invert-image | width = 120px
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 1196-01-6 | ATC_prefix = R05 | ATC_suffix = CA11 | PubChem = 92874 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 83838 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 2426701 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2XP0J7754U | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 78316
<!--Chemical data--> | C=10 | H=14 | O=1 | smiles = O=C1\C=C(/[C@@H]2C[C@H]1C2(C)C)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C10H14O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-8H,5H2,1-3H3/t7-,8+/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = DCSCXTJOXBUFGB-JGVFFNPUSA-N }}
'''Levoverbenone''' is an expectorant. It is the (−)-isomer of verbenone.<ref>{{cite book | veditors = Kutscher B, Kleemann A |title=Ullmann's Pharmaceuticals | volume = 2 |date=2022 |publisher=John Wiley & Sons |location=Weinheim, Germany |isbn=978-3-527-80733-8 |pages=826 |url=https://books.google.com/books?id=94JlEAAAQBAJ&pg=RA4-PA100}}</ref>
== References == {{Reflist}}
== External links == * {{cite web | title = Levoverbenone | url = https://pubchem.ncbi.nlm.nih.gov/compound/Levoverbenone | work = PubChem | publisher = National Center for Biotechnology Information (NCBI), U.S. National Library of Medicine }}
{{Cough and cold preparations}}
Category:Antitussives Category:Enones Category:Enantiopure drugs Category:Monoterpenes Category:Cycloalkenes
{{respiratory-system-drug-stub}} {{stereochemistry-stub}}