{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443418087 | ImageFile = Lactide.svg | ImageSize = 120px | PIN = 3,6-Dimethyl-1,4-dioxan-2,5-dione | OtherNames = Dilactid |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 4511-42-6 | CASNo_Comment = [(''S'',''S'')-Lactide] | CASNo2_Ref = {{cascite|changed|??}} | CASNo2 = 25038-75-9 | CASNo2_Comment = [(''R'',''R'')-Lactide] | CASNo3_Ref = {{cascite|changed|??}} | CASNo3 = 13076-19-2 | CASNo3_Comment = [(''R'',''S'')-Lactide = ''meso''-Lactide] | CASNo4_Ref = {{cascite|correct|CAS}} | CASNo4 = 26680-10-4 | CASNo4_Comment = [mixture of three isomers] | CASNo5_Ref = {{cascite|correct|CAS}} | CASNo5 = 95-96-5 | CASNo5_Comment = [mixture of three isomers]<ref name=SigmaAldrich>[http://www.sigmaaldrich.com/catalog/product/aldrich/303143?lang=en&region=GB Sigma Aldrich product page for lactide] Retrieved 8th of July 2015</ref> | UNII_Ref = {{fdacite|correct|FDA}} | UNII = IJ13TO4NO1 | UNII_Comment = [(''S'',''S'')-Lactide] | UNII4_Ref = {{fdacite|correct|FDA}} | UNII4 = 9J7G894K2M | UNII4_Comment = [mixture of three isomers] | UNII5_Ref = {{fdacite|correct|FDA}} | UNII5 = 7EH08MWO6M | UNII5_Comment = [mixture of three isomers] | PubChem = 7272 | ChemSpiderID = 7002 | EC_number = 202-468-3 | StdInChI=1S/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3 | StdInChIKey = JJTUDXZGHPGLLC-UHFFFAOYSA-N | SMILES = CC1C(=O)OC(C(=O)O1)C }} |Section2={{Chembox Properties | C = 6 | H = 8 | O = 4 | MeltingPtC = 95 to 97 | MeltingPt_notes = [(''S'',''S'')-Lactide and (''R'',''R'')-Lactide]<ref name=roempp>[http://www.roempp.com/prod/index1.html Römpp Online Chemielexikon Version 3.3] aufgerufen am 25. März 2009</ref> | Solubility = Hydrolyses to lactic acid<ref name=roempp /> | SolubleOther = soluble in chloroform, methanol<br />slightly soluble in benzene <ref name=roempp /> }} |Section7={{Chembox Hazards | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|319}} | PPhrases = {{P-phrases|264|280|305+351+338|337+313}} }} }} '''Lactide''' is the lactone cyclic ester derived by multiple esterification between two (usually) or more molecules from lactic acid (2-hydroxypropionic acid) or other hydroxy carboxylic acid. They are designated as dilactides, trilactides, etc., according to the number of hydroxy acid residues. All lactides are colorless or white solids. The dilactide derived from lactic acid has the formula {{chem2|[CH(CH3)CO2]2}}. This lactide has attracted interest because it is derived from abundant renewable resources and is the precursor to a biodegradable plastic.<ref name=Ullmanns>{{cite encyclopedia|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|chapter=Polymers, Biodegradable|author=Andreas Künkel |author2=Johannes Becker |author3=Lars Börger |author4=Jens Hamprecht |author5=Sebastian Koltzenburg |author6=Robert Loos |author7=Michael Bernhard Schick |author8=Katharina Schlegel |author9=Carsten Sinkel |author10=Gabriel Skupin |author11=Motonori Yamamoto |pages=1–29|year=2016|publisher=Wiley-VCH|place=Weinheim|doi=10.1002/14356007.n21_n01.pub2|isbn=978-3-527-30673-2|doi-access=free}}</ref>

==Stereoisomers== The dilactide derived from lactic acid can exist in three different stereoisomeric forms. This complexity arises because lactic acid is chiral. These enantiomers do not racemize readily.

{{multiple image | align = left | direction = vertical | width = 350 | image1 = Lactide Stereoisomers Structural Formulae.png | alt1 = Chemical structures of three isomers | caption1 = (''R'',''R'')-Lactide (left above), (''S'',''S'')-lactide (right above) and ''meso''-lactide (below) }}{{clear-left}}

All three stereoisomers undergo epimerisation in the presence of organic and inorganic bases in solution.<ref>{{Cite journal|last=Shuklov|first=Ivan A.|last2=Jiao|first2=Haijun|last3=Schulze|first3=Joachim|last4=Tietz|first4=Wolfgang|last5=Kühlein|first5=Klaus|last6=Börner|first6=Armin|date=2011-03-02|title=Studies on the epimerization of diastereomeric lactides|journal=Tetrahedron Letters|volume=52|issue=9|pages=1027–1030|doi=10.1016/j.tetlet.2010.12.094|issn=0040-4039}}</ref>{{clear left}}

==Polymerization== Lactide can be polymerized to polylactic acid (polylactide). Depending on the catalyst, syndiotactic or a heterotactic polymers can result. The resulting materials, polylactic acid, have many attractive properties.<ref>{{cite book | isbn = 978-0-470-29366-9 | title = Poly(lactic acid): Synthesis, Structures, Properties, Processing, and Applications | author1 = R. Auras | author2 = L.-T. Lim | author3= S. E. M. Selke |author4= H. Tsuji | publisher = Wiley | year = 2010 }}</ref><ref>{{cite journal|title=Controlled Ring-Opening Polymerization of Lactide and Glycolide|author1=Odile Dechy-Cabaret |author2=Blanca Martin-Vaca |author3=Didier Bourissou | journal=Chem. Rev.|year=2004|volume=104|issue=12|pages=6147–76|doi=10.1021/cr040002s|pmid=15584698}}</ref>

:400px

== References == {{reflist}}

Category:Lactones Category:Dioxanes Category:Monomers Category:Dimers (chemistry)