{{more footnotes|date=October 2013}} {{more citations needed|date=October 2013}} {{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 401009231 | Name = Kaempferide | ImageFile = Kaempferide.svg | ImageSize = 250px | ImageName = Kaempferide structure | IUPACName = 3,5,7-Trihydroxy-4′-methoxyflavone | SystematicName = 3,5,7-Trihydroxy-2-(4-methoxyphenyl)-4''H''-1-benzopyran-4-one | OtherNames = Kaempferid<br />4′-Methylkaempferol<br />Kaempferol 4′-methyl ether<br />4′-''O''-Methylkaempferol |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 491-54-3 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 508XL61MPD | PubChem = 5281666 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 40919 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 6099 | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = C10098 | SMILES = COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 4444985 | SMILES2 = COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O | InChI = 1/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 | InChIKey = SQFSKOYWJBQGKQ-UHFFFAOYAC | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = SQFSKOYWJBQGKQ-UHFFFAOYSA-N }} |Section2={{Chembox Properties | Formula = C<sub>16</sub>H<sub>12</sub>O<sub>6</sub> | MolarMass = 300.26 g/mol | Density = | MeltingPt = | BoilingPt = }} }} '''Kaempferide''' is an ''O''-methylated flavonol, a type of chemical compound. It can be found in ''Kaempferia galanga'' (aromatic ginger). It has been noted to inhibit pancreatic cancer growth by blockading an EGFR-related pathway.<ref>{{cite journal|title=Kaempferol Inhibits Pancreatic Cancer Cell Growth and Migration through the Blockade of EGFR-Related Pathway In Vitro|journal=PLOS ONE|volume=11|issue=5|article-number=e0155264|doi=10.1371/journal.pone.0155264|pmid=27175782|pmc=4866780|year=2016|last1=Lee|first1=Jungwhoi|last2=Kim|first2=Jae Hoon|bibcode=2016PLoSO..1155264L|doi-access=free}}</ref>
== Metabolism == The enzyme kaempferol 4'-''O''-methyltransferase uses ''S''-adenosyl-<small>L</small>-methionine and kaempferol to produce ''S''-adenosyl-<small>L</small>-homocysteine and kaempferide.
== Glycosides == Icariin is the tert-amyl alcohol derivative of kaempferide 3,7-''O''-diglycoside.
==References== {{Reflist}}
== External links == * [http://www.hmdb.ca/metabolites/HMDB0037441 Kaempferide at the HMDB]
{{flavonol}}
Category:O-methylated flavonols Category:Triols
{{Aromatic-stub}}