{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 407439500 | image = Ioversol.png | image_class = skin-invert-image | alt =
<!--Clinical data--> | tradename = Optiray | Drugs.com = {{drugs.com|MTM|ioversol}} | pregnancy_AU = B1 | pregnancy_category = | routes_of_administration = | ATC_prefix = V08 | ATC_suffix = AB07
| legal_AU = Unscheduled | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = Low | metabolism = None | elimination_half-life = 90 min | excretion = Kidneys
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 87771-40-2 | PubChem = 3741 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB09134 | UNII_Ref = {{fdacite|changed|FDA}} | UNII = N3RIB7X24K | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D01555 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1200614 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 3610
<!--Chemical data--> | IUPAC_name = 1-''N'',3-''N-bis''(2,3-dihydroxypropyl)-5-[2-hydroxy-''N''-(2-hydroxyethyl)acetamido]-2,4,6-triiodobenzene-1,3-dicarboxamide | C=18 | H=24 | I=3 | N=3 | O=9 | smiles = C(CO)N(C1=C(C(=C(C(=C1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C18H24I3N3O9/c19-13-11(17(32)22-3-8(29)5-26)14(20)16(24(1-2-25)10(31)7-28)15(21)12(13)18(33)23-4-9(30)6-27/h8-9,25-30H,1-7H2,(H,22,32)(H,23,33) | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = AMDBBAQNWSUWGN-UHFFFAOYSA-N }} '''Ioversol''' (INN; trade name '''Optiray''') is an organoiodine compound that is used as a contrast medium. It features both a high iodine content, as well as several hydrophilic groups. It is used in clinical diagnostics including arthrography, angiocardiography and urography.<ref name="Medscape">{{cite web |title=Optiray (ioversol) dosing, indications, interactions, adverse effects, and more |url=https://reference.medscape.com/drug/optiray-ioversol-343759#0 |website=reference.medscape.com |access-date=9 January 2021}}</ref><ref name="Chen">{{cite book | vauthors = Chen Y, Huang X, Huang S, Matchett M | veditors = Wang PG, He W |title=Hydrophilic Interaction Liquid Chromatography (HILIC) and Advanced Applications |publisher=CRC Press |isbn=978-1-4398-0753-8 |page=295-30 |chapter-url= https://books.google.com/books?id=psoSZYLnGkcC&dq=ioversol&pg=PA295 |language=en |chapter=13. Fast-in-process method for the determination ioversol and related polar compounds by hydrophilic interactive chromatography| date = 17 February 2011 }}</ref>
== References == {{reflist}}
{{Contrast media}} {{Portal bar | Medicine}}
Category:Radiocontrast agents Category:Benzamides Category:Acetanilides Category:Iodobenzene derivatives
{{pharmacology-stub}}