{{Short description|Chemical compound}} {{Infobox drug | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477209373 | IUPAC_name = (3''S'',8''S'',9''S'',10''S'',13''R'',14''S'',17''R'')-10-(iodomethyl)-13-methyl-17-[(2''R'')-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-3-ol | image = 19-Iodocholesterol.png | image_class = skin-invert-image | width = 250
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number_Ref = | CAS_number = 37414-03-2 | CAS_supplemental = | class = | ATC_prefix = V09 | ATC_suffix = XA02 | ATC_supplemental = (<sup>131</sup>I) | PubChem = 3032874 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 20086815 | UNII = 4A4E6EXB6U | KEGG = | ChEBI = | ChEMBL =
<!--Chemical data--> | C=27 | H=45 | I=1 | O=1 | SMILES = CC(C)CCC[C@@H](C)[C@H]3CC[C@H]2[C@@H]4C\C=C1\C[C@@H](O)CC[C@]1(CI)[C@H]4CC[C@@]23C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C27H45IO/c1-18(2)6-5-7-19(3)23-10-11-24-22-9-8-20-16-21(29)12-15-27(20,17-28)25(22)13-14-26(23,24)4/h8,18-19,21-25,29H,5-7,9-17H2,1-4H3/t19-,21+,22+,23-,24+,25+,26-,27-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = FIOAEFCJGZJUPW-FTLVODPJSA-N | synonyms = Iodocholesterol; 19-Iodocholesterol; Iodocholesterol (<sup>131</sup>I); 19-Iodocholest-5-en-3β-ol }}
'''Iodocholesterol''', or '''19-iodocholesterol''', also as '''iodocholesterol (<sup>131</sup>I)''' (INN) and '''NP-59''', is a derivative of cholesterol with an iodine atom in the C19 position and a radiopharmaceutical.<ref name="Elks2014">{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA692|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=692–}}</ref><ref name="ClarkSociety2003">{{cite book| vauthors = Clark OH, ((American Cancer Society)) |title=Endocrine Tumors|url=https://books.google.com/books?id=ZlqGWp3UZ6oC&pg=PA124|year=2003|publisher=PMPH-USA|isbn=978-1-55009-134-2|pages=124–}}</ref> When the iodine atom is a radioactive isotope (iodine-125 or iodine-131), it is used as an adrenal cortex radiotracer in the diagnosis of patients suspected of having Cushing's syndrome, hyperaldosteronism,<ref>{{cite journal | vauthors = Fischer M, Rosenbach EA, Glaser B, Stokar J | title = NP-59 Scintigraphy for Primary Aldosteronism Lateralization in a Patient With Polycystic Kidney Disease | language = English | journal = AACE Clinical Case Reports | volume = 9 | issue = 3 | pages = 97–98 | date = 2023-02-24 | pmid = 37251975 | pmc = 10213608 | doi = 10.1016/j.aace.2023.02.006 | doi-access = free| s2cid = 257212197 }}</ref> pheochromocytoma, and adrenal remnants following total adrenalectomy.<ref name="Elks2014" /><ref name="ClarkSociety2003" />
== References == {{Reflist|2}}
{{Radiopharmaceuticals}}
Category:Cholestanes Category:Organoiodides Category:Radiopharmaceuticals
{{drug-stub}} {{Nuclear-med-stub}}