{{Short description|Blue dye derived from indigo}} {{About|the blue dye derived from indigo|the unrelated red dye|Carmine||Carmine (disambiguation)}} {{cs1 config|name-list-style=vanc|display-authors=6}} {{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477001402 | ImageFile = Indigo carmine.svg | ImageClass = skin-invert-image | ImageSize = 300px | ImageFile1 = Indigo-carmine-3D-balls.png | ImageClass1 = bg-transparent | ImageSize1 =300px | PIN = Disodium [2(2′)''E'']-3,3′-dioxo-1,1′,3,3′-tetrahydro[2,2′-biindolylidene]-5,5′-disulfonate | OtherNames = {{Unbulleted list|indigotine|5,5′-indigodisulfonic acid sodium salt|Brilliant Indigo|4 G|C.I. Acid Blue 74|C.I. 73015|CI Food Blue 1|FD&C Blue 2|Sicovit Indigotin 85|E132|indigotindisulfonate sodium|Caustic Blue}} |Section1={{Chembox Identifiers | Identifiers_ref = <!-- indexlabeling--> | index_label = | index1_label = | indexlist_caption = | index_comment = | index1_comment = <!--CASNo, +ix 1–5--> | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 860-22-0 | CASNo_Comment = <!--ChEBI, +ix 1–5--> | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 31695 | ChEBI_Comment = <!--ChEMBL, +ix 1–5--> | ChEMBL = 2105023 | ChEMBL_Comment = <!--ChemSpiderID, +ix 1–5--> | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4447431 | ChemSpiderID_Comment = <!--DrugBank, +ix 1–5--> | DrugBank = DB11577 | DrugBank_Comment = | DrugBank1 = DBSALT001752 | DrugBank1_Comment = | EC_number = 212-728-8 <!--IUPHAR_ligand, +ix 1–5--> | IUPHAR_ligand = | IUPHAR_ligand_Comment = <!--KEGG, +ix 1–5--> | KEGG = D01563 | KEGG_Comment = <!--PubChem, +ix 1–5--> | PubChem = 2723854 | PubChem_Comment = <!--SMILES, Jmol 1–5--> | SMILES = [Na+].[Na+].[O-]S(=O)(=O)c3cc4C(=O)\C(=C2\C(=O)c1cc(ccc1N2)S([O-])(=O)=O)Nc4cc3 | SMILES_Comment = <!--StdInChI--> | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C16H10N2O8S2.2Na/c19-15-9-5-7(27(21,22)23)1-3-11(9)17-13(15)14-16(20)10-6-8(28(24,25)26)2-4-12(10)18-14;;/h1-6,17-18H,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2/b14-13+;; | StdInChI_Comment = | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = KHLVKKOJDHCJMG-QDBORUFSSA-L <!--InChI, InChIKey: index 1–5--> | InChI = 1/C16H10N2O8S2.2Na/c19-15-9-5-7(27(21,22)23)1-3-11(9)17-13(15)14-16(20)10-6-8(28(24,25)26)2-4-12(10)18-14;;/h1-6,17-18H,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2/b14-13+;; | InChI_Comment = | InChIKey = KHLVKKOJDHCJMG-AKPRSONXBD <!--UNII, +ix 1–5--> | UNII_Ref = {{fdacite|correct|FDA}} | UNII = D3741U8K7L | UNII_Comment = <!--non-index parameters--> | Abbreviations = | Beilstein = | Gmelin = | MeSHName = | UNNumber = }} |Section2={{Chembox Properties | Formula = C<sub>16</sub>H<sub>8</sub>N<sub>2</sub>Na<sub>2</sub>O<sub>8</sub>S<sub>2</sub> | MolarMass = 466.36 g/mol | Appearance = purple solid | Density = | MeltingPt = >{{convert|300|C}} | BoilingPt = | Solubility = 10 g/L ({{convert|25|C}}) }} |Section3={{Chembox Hazards | GHSPictograms = {{GHS exclamation mark}}<ref name=sigma>{{cite web|title=Indigo carmine|url=http://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=TH&language=en&productNumber=131164&brand=SIAL&PageToGoToURL=http%3A%2F%2Fwww.sigmaaldrich.com%2Fcatalog%2Fproduct%2Fsial%2F131164%3Flang%3Den|website=Sigma Aldrich|access-date=15 Feb 2022}}</ref> | GHSSignalWord = '''Warning''' | HPhrases = {{H-phrases|302}}<ref name=sigma /> | PPhrases = | MainHazards = | FlashPt = | AutoignitionPt = | NFPA-H = 2 | NFPA-F = 1 | NFPA-R = 0 | NFPA-S = }} | Section6 = {{Chembox Pharmacology | Pharmacology_ref = | ATCCode_prefix = V04 | ATCCode_suffix = CH02 | ATC_Supplemental = | ATCvet = | Licence_EU = | INN = | INN_EMA = | Licence_US = | Legal_status = | Legal_AU = | Legal_AU_comment = | Legal_CA = | Legal_CA_comment = | Legal_NZ = | Legal_NZ_comment = | Legal_UK = | Legal_UK_comment = | Legal_US = Rx-only | Legal_US_comment = <ref name="Bludigo FDA label">{{cite web | title=Bludigo- indigotindisulfonate sodium injection | website=DailyMed | date=7 November 2022 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=73f246c4-b127-452e-856f-134b56cb8870 | access-date=21 January 2023}}</ref> | Legal_EU = | Legal_EU_comment = | Legal_UN = | Legal_UN_comment = | Pregnancy_category = | Pregnancy_AU = | Pregnancy_AU_comment = | Dependence_liability = | AdminRoutes = | Bioavail = | ProteinBound = | Metabolism = | Metabolites = | OnsetOfAction = | HalfLife = | DurationOfAction = | Excretion = }} |Section7={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
{{Infobox drug | drug_name = Indigotindisulfonate sodium | INN = | type = <!-- empty --> | image = Indigo carmine.jpg | width = | alt = | caption = Container of indigotindisulfonate sodium for medical use
<!-- Clinical data --> | pronounce = | tradename = Bludigo | Drugs.com = | MedlinePlus = | licence_CA = <!-- Health Canada may use generic or brand name (generic name preferred) --> | licence_EU = <!-- EMA uses INN (or special INN_EMA) --> | DailyMedID = Indigotindisulfonate | licence_US = <!-- FDA may use generic or brand name (generic name preferred) --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU_comment = | pregnancy_category = | routes_of_administration = | class = | ATCvet = | ATC_prefix = | ATC_suffix = | ATC_supplemental =
<!-- Legal status --> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_AU_comment = | legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F --> | legal_BR_comment = | legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA_comment = | legal_DE = <!-- Anlage I, II, III or Unscheduled --> | legal_DE_comment = | legal_NZ = <!-- Class A, B, C --> | legal_NZ_comment = | legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --> | legal_UK_comment = | legal_US = | legal_US_comment = | legal_EU = | legal_EU_comment = | legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> | legal_UN_comment = | legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =
<!-- Identifiers --> | CAS_number = | CAS_supplemental = | PubChem = | IUPHAR_ligand = | DrugBank = | ChemSpiderID = | UNII = | KEGG = | ChEBI = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms =
<!-- Chemical and physical data --> | IUPAC_name = | chemical_formula_ref = | chemical_formula = | C= | H= | Ag= | Al= | As= | Au= | B= | Bi= | Br= | Ca= | Cl= | Co= | F= | Fe= | Gd= | I= | K= | Li= | Mg= | Mn= | N= | Na= | O= | P= | Pt= | S= | Sb= | Se= | Sr= | Tc= | Zn= | charge= | molecular_weight = | molecular_weight_comment = | SMILES = | StdInChI = | StdInChI_comment = | StdInChIKey = | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }}
'''Indigo carmine''', or '''5,5′-indigodisulfonic acid sodium salt''', is an organic salt derived from indigo by aromatic sulfonation, which renders the compound soluble in water. Like indigo, it produces a blue color, and is used in food and other consumables, cosmetics, and as a medical contrast agent and staining agent; it also acts as a pH indicator. It is approved for human consumption in the United States and European Union.<ref name="FDA colors">[https://web.archive.org/web/20090611073852/http://www.fda.gov/ForIndustry/ColorAdditives/ColorAdditiveInventories/ucm115641.htm Summary of Color Additives for Use in United States in Foods, Drugs, Cosmetics, and Medical Devices], Food and Drug Administration</ref><ref name=FSAlist>[https://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist Current EU approved additives and their E Numbers], Food Standards Agency, 26 November 2010</ref> It has the E number '''E132''', and is named '''Blue No. 2''' by the US Federal Food, Drug, and Cosmetic Act.<ref>{{cite web |title=Regulatory Status of Color Additives: FD&C Blue No. 2 |url=https://hfpappexternal.fda.gov/scripts/fdcc/index.cfm?set=ColorAdditives&id=FDCBlue2 |website=U.S. Department of Health and Human Services |access-date=29 April 2025}}</ref>
==Uses== {{pH_indicator_template|indicator_name=Indigo Carmine|low_pH=11.4|high_pH=13.0|low_pH_color=blue|low_pH_text=white|high_pH_color=yellow}} thumb|Experiment using indigo carmine as an indicator Indigo carmine in a 0.2% aqueous solution is blue at pH 11.4 and yellow at 13.0. Indigo carmine is also a redox indicator, turning yellow upon reduction. Another use is as a dissolved ozone indicator<ref name="pmid2729594">{{cite journal | vauthors = Takeuchi K, Ibusuki T | title = Quantitative determination of aqueous-phase ozone by chemiluminescence using indigo-5,5'-disulfonate | journal = Analytical Chemistry | volume = 61 | issue = 6 | pages = 619–623 | date = March 1989 | pmid = 2729594 | doi = 10.1021/ac00181a025 }}</ref> through the conversion to isatin-5-sulfonic acid.<ref name="pmid2729594" /> This reaction has been shown not to be specific to ozone: it also detects superoxide, an important distinction in cell physiology.<ref name="pmid14978029">{{cite journal | vauthors = Kettle AJ, Clark BM, Winterbourn CC | title = Superoxide converts indigo carmine to isatin sulfonic acid: implications for the hypothesis that neutrophils produce ozone | journal = The Journal of Biological Chemistry | volume = 279 | issue = 18 | pages = 18521–18525 | date = April 2004 | pmid = 14978029 | doi = 10.1074/jbc.M400334200 | doi-access = free }}</ref> It is also used as a dye in the manufacturing of pharmaceutical capsules.
=== Medical uses === '''Indigotindisulfonate sodium''', sold under the brand name '''Bludigo''', is used as a contrast agent during surgical procedures.<ref name="Bludigo FDA label" /> It is indicated for use in cystoscopy in adults following urological and gynecological procedures.<ref name="Bludigo FDA label" /><ref name="FDA approval letter">{{cite web | title = NDA APPROVAL: Bludigo (indigotindisulfonate sodium) injection | url = https://www.accessdata.fda.gov/drugsatfda_docs/appletter/2022/216264Orig1s000ltr.pdf | archive-url = https://web.archive.org/web/20220712082016/https://www.accessdata.fda.gov/drugsatfda_docs/appletter/2022/216264Orig1s000ltr.pdf | url-status = dead | archive-date = July 12, 2022 | publisher = U.S. Food and Drug Administration }} {{PD-notice}}</ref> It was approved for medical use in the United States in July 2022.{{specify|Presumably means only this particular product?|date=August 2024}}<ref name="Bludigo FDA label" /><ref name="FDA approval letter" />
In obstetric surgery, it may be used to detect amniotic fluid leaks. In urologic surgery, intravenous indigo carmine can be used to highlight portions of the urinary tract. The dye is filtered rapidly by the kidneys from the blood, and colors the urine blue. However, the dye can cause a potentially dangerous acute increase in blood pressure in some cases.<ref>{{cite journal | vauthors = Craik JD, Khan D, Afifi R |title=The Safety of Intravenous Indigo Carmine to Assess Ureteric Patency During Transvaginal Uterosacral Suspension of the Vaginal Vault |journal=Journal of Pelvic Medicine & Surgery |date=January–February 2009 |volume=15 |issue=1 |pages=11–15 |doi=10.1097/SPV.0b013e3181986ace }}</ref>
Indigo carmine stain is not absorbed into cells, so it is applied to tissues to enhance the visibility of mucosa. This leads to its use for examination and diagnosis of benign and malignant lesions and growths on mucosal surfaces of the body.<ref>{{cite journal | vauthors = Jang JY | title = The Past, Present, and Future of Image-Enhanced Endoscopy | journal = Clinical Endoscopy | volume = 48 | issue = 6 | pages = 466–475 | date = November 2015 | pmid = 26668791 | pmc = 4676674 | doi = 10.5946/ce.2015.48.6.466 | doi-access = free }}</ref>
=== Food, pharmaceutical, cosmetic, and scientific uses === Indigo carmine is one of the few blue food colorants. Others include the anthocyanidins and rare substances such as variegatic acid and popolohuanone.<ref>{{cite journal | vauthors = Newsome AG, Culver CA, van Breemen RB | title = Nature's palette: the search for natural blue colorants | journal = Journal of Agricultural and Food Chemistry | volume = 62 | issue = 28 | pages = 6498–6511 | date = July 2014 | pmid = 24930897 | doi = 10.1021/jf501419q | bibcode = 2014JAFC...62.6498N }}</ref>
==Safety and regulation== {{Missing information|article|legal status outside US/EU and most usages|date=August 2024}} Indigo carmine shows "genotoxicity, developmental toxicity or modifications of haematological parameters in chronic toxicity studies". Only at 17 mg/kg of body weight per day were effects on testes observed.<ref>{{cite journal | vauthors = Amchova P, Kotolova H, Ruda-Kucerova J | title = Health safety issues of synthetic food colorants | journal = Regulatory Toxicology and Pharmacology | volume = 73 | issue = 3 | pages = 914–922 | date = December 2015 | pmid = 26404013 | doi = 10.1016/j.yrtph.2015.09.026 }}</ref>
== References == {{reflist}}
{{Food colorings}} {{Diagnostic agents}} {{Portal bar | Medicine}}
{{DEFAULTSORT:Indigo Carmine}} Category:PH indicators Category:Sulfonates Category:Organic sodium salts Category:Indoles Category:Enones Category:Food colorings Category:Redox indicators Category:E-number additives Category:Acid dyes