{{Chembox |Section1={{Chembox Identifiers | index1_label = 1 | index2_label = 2 | index4_label = 4 | index5_label = 5 | CASNo1 = 6351-10-6 | CASNo1_Comment = racemic | CASNo2 = 4254-29-9 | CASNo4 = 1641-41-4 | CASNo5 = 1470-94-6 | Beilstein = 1:2042960, | ChEBI1 = 16697 | ChEMBL1 = 4564909 | ChEBI5 = 59311 | ChEMBL5 = 3218378 | ChemSpiderID1 = 21394 | ChemSpiderID2 = 70326 | ChemSpiderID4 = 66840 | ChemSpiderID5 = 14390 | DTXSID4 = DTXSID00167708 | DTXSID5 = DTXSID0051732 | EC_number1 = 228-755-3 | EC_number2 = 224-230-8 | EC_number4 = 216-691-9 | EC_number5 = 216-006-3 | KEGG1 = C01710 | PubChem1 = 22819 | PubChem2 = 77936 | PubChem4 = 74233 | PubChem5 = 15118 | UNII5 = 9Z94H6F15T | UNII1 = LHG5BD7LOR | UNII2 = B77NA7SM29 | UNII4 = 7PJT17BE05 | SMILES1 = OC1CCc2ccccc21 | InChI1=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2 | InChIKey1 = YIAPLDFPUUJILH-UHFFFAOYSA-N | SMILES2 = OC1Cc2ccccc2C1 | InChI2 = 1S/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2 | InChIKey2 = KMGCKSAIIHOKCX-UHFFFAOYSA-N | SMILES4 = Oc1cccc2c1CCC2 | InChI4=1S/C9H10O/c10-9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2 | InChIKey4 = DPHNJPUOMLRELT-UHFFFAOYSA-N | SMILES5 = Oc1ccc2c(c1)CCC2 | InChI5=1S/C9H10O/c10-9-5-4-7-2-1-3-8(7)6-9/h4-6,10H,1-3H2 | InChIKey5 = PEHSSTUGJUBZBI-UHFFFAOYSA-N }} |Section2={{Chembox Properties | C=9|H=10|O=1 }} |Section8={{Chembox Related }} }}
'''Indanols''' are a class of organic compounds, some of which are useful in medicine or industry. They are hydroxy derivatives of the parent compound called indane (also known as indan).
==Isomers== <gallery packed heights="100px"> File:1-indanol.svg|1-indanol (racemic), m.p. 54.8; R enantiomer, m.p. 67-68°C File:2-indanol.svg|2-indanol, m.p. 68-69 °C File:4-indanol.svg|4-indanol, m.p. 42 °C File:5-indanol.svg|5-indanol, m.p. 58 °C </gallery>
Five isomers are possible, two of which are phenols (4- and 5-indanols). Three isomers feature hydroxyl group on the five-membered ring, including an enantiomeric pair of 1-indanol. 1-Indanol can be produced by reduction of 1-indanone.<ref>{{cite journal |title=(S)-Tetrahydro-1-Methyl-3,3-Diphenyl-1H,3H-Pyrrolo-[1,2-c][1,3,2]Oxazaborole-Borane Complex |journal=Organic Syntheses |date=1997 |volume=74 |page=50 |doi=10.15227/orgsyn.074.0050}}</ref> 5-indanol can be prepared by sulfonation of indane, following by base cleavage of the indane-5-sulfonate.<ref>{{cite book |last1=Fiege |first1=Helmut |last2=Voges |first2=Heinz-Werner |last3=Hamamoto |first3=Toshikazu |last4=Umemura |first4=Sumio |last5=Iwata |first5=Tadao |last6=Miki |first6=Hisaya |last7=Fujita |first7=Yasuhiro |last8=Buysch |first8=Hans-Josef |last9=Garbe |first9=Dorothea |last10=Paulus |first10=Wilfried |title=Ullmann's Encyclopedia of Industrial Chemistry |chapter=Phenol Derivatives |date=2000 |doi=10.1002/14356007.a19_313 |isbn=978-3-527-30385-4 }}</ref>
==References== <references />
* Category:Secondary alcohols