{{for|the audio software|I-Doser}} {{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 451730222 | Reference = <ref>''Merck Index'', 11th Edition, '''4818'''</ref> | ImageFile = Idose.png | ImageClass = skin-invert | ImageFile1 = D-Idose-chain-3D-balls.png | ImageClass1 = bg-transparent | ImageSize = 180px | IUPACName = Idose<br> ''ido''-Hexose<ref>{{Cite web |date=1996 |title=Nomenclature of Carbohydrates (Recommendations 1996) - Appendix |url=https://iupac.qmul.ac.uk/2carb/app.html |access-date=2025-11-28 |website=iupac.qmul.ac.uk}}</ref> | SystematicName = (3''S'',4''R'',5''R'',6''R'')-6-(Hydroxymethyl)oxane-2,3,4,5-tetrol | Section1 = {{Chembox Identifiers | CASNo = 5978-95-0 | CASNo_Comment = natural enantiomer (D) | CASNo1 = 2152-76-3 | CASNo1_Comment = racemate | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2YL114VI04 | PubChem = 441034 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 389853 | SMILES = O[C@@H]1[C@@H](O)[C@H](OC(O)[C@H]1O)CO | InChI = 1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4-,5+,6?/m1/s1 | InChIKey = WQZGKKKJIJFFOK-YIDFTEPTBS | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4-,5+,6?/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = WQZGKKKJIJFFOK-YIDFTEPTSA-N }} | Section2 = {{Chembox Properties | C=6 | H=12 | O=6 | Appearance = white solid | Density = | MeltingPtC = 132 | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = }} }}

'''Idose''' is a hexose, a six carbon monosaccharide. It has an aldehyde group and is thus an aldose. Idose is not found in nature, but its oxidized derivative iduronic acid, is a component of dermatan sulfate and heparan sulfate, which are glycosaminoglycans. The first and third hydroxyls point the opposite way from the second and fourth. It is made by aldol condensation of <small>D</small>- and <small>L</small>-glyceraldehyde. <small>L</small>-Idose is a C-5 epimer of <small>D</small>-glucose.

It can be identified by mass spectrometry.<ref>{{cite journal |doi=10.1007/s13361-014-1072-z |title=Complete Hexose Isomer Identification with Mass Spectrometry |date=2015 |last1=Nagy |first1=Gabe |last2=Pohl |first2=Nicola L. B. |journal=Journal of the American Society for Mass Spectrometry |volume=26 |issue=4 |pages=677–685 |pmid=25652933 |bibcode=2015JASMS..26..677N}}</ref>

==References== <references/>

{{Carbohydrates}}

Category:Aldohexoses Category:Pyranoses

{{Ether-stub}}