{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 426194395 | ImageFile = Icilin.svg | ImageSize = 250px | PIN = 3-(2-Hydroxyphenyl)-6-(3-nitrophenyl)-3,4-dihydropyrimidin-2(1''H'')-one | OtherNames = 1-(2-Hydroxyphenyl)-4-(3-nitrophenyl)-3,6-dihydropyrimidin-2-one<br />AG-3-5 |Section1={{Chembox Identifiers | Abbreviations = | CASNo_Ref = {{cascite|correct|??}} | CASNo = 36945-98-9 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = CS70PZQ4QJ | EINECS = | PubChem = 161930 | IUPHAR_ligand = 2429 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 142218 | SMILES = O=C3N(c1c(O)cccc1)C/C=C(/c2cccc([N+]([O-])=O)c2)N3 | InChI = 1/C16H13N3O4/c20-15-7-2-1-6-14(15)18-9-8-13(17-16(18)21)11-4-3-5-12(10-11)19(22)23/h1-8,10,20H,9H2,(H,17,21) | InChIKey = RCEFMOGVOYEGJN-UHFFFAOYAQ | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C16H13N3O4/c20-15-7-2-1-6-14(15)18-9-8-13(17-16(18)21)11-4-3-5-12(10-11)19(22)23/h1-8,10,20H,9H2,(H,17,21) | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = RCEFMOGVOYEGJN-UHFFFAOYSA-N | RTECS = | MeSHName = | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = }} |Section2={{Chembox Properties | Formula = C<sub>16</sub>H<sub>13</sub>N<sub>3</sub>O<sub>4</sub> | MolarMass = 311.29 g/mol | Appearance = | Density = | MeltingPt = | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = | SolubleOther = | Solvent = | LogP = | VaporPressure = | HenryConstant = | AtmosphericOHRateConstant = | pKa = | pKb = }} |Section3={{Chembox Structure | CrystalStruct = | Coordination = | MolShape = }} |Section4={{Chembox Thermochemistry | DeltaHf = | DeltaHc = | Entropy = | HeatCapacity = }} |Section5={{Chembox Pharmacology | AdminRoutes = | Bioavail = | Metabolism = | HalfLife = | ProteinBound = | Excretion = | Legal_status = | Legal_US = | Legal_UK = | Legal_AU = | Legal_CA = | Pregnancy_category = | Pregnancy_AU = | Pregnancy_US = }} |Section6={{Chembox Explosive | ShockSens = | FrictionSens = | DetonationV = | REFactor = }} |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | LD50 = | PEL = }} |Section8={{Chembox Related | OtherAnions = | OtherCations = | OtherFunction = | OtherFunction_label = | OtherCompounds = }} }}

'''Icilin''' ('''AG-3-5''') is a synthetic super-agonist of the transient receptor potential M8 (TRPM8) ion channel. Although structurally not related to menthol, it produces an extreme sensation of cold, both in humans and animals. It is almost 200 times more potent than menthol, and 2.5 times more efficacious.<ref name="pmid6131976">{{cite journal |vauthors=Wei ET, Seid DA |title=AG-3-5: a chemical producing sensations of cold |journal=J. Pharm. Pharmacol. |volume=35 |issue=2 |pages=110–2 |year=1983 |pmid=6131976 |doi=10.1111/j.2042-7158.1983.tb04279.x|s2cid=42844929 }}</ref> Despite their similar effects, icilin activates the TRPM8 receptor in a different way than menthol does.<ref name="pmid15190109">{{cite journal |vauthors=Andersson DA, Chase HW, Bevan S |year=2004 |title=TRPM8 activation by menthol, icilin, and cold is differentially modulated by intracellular pH |journal=J. Neurosci. |volume=24 |issue=23 |pages=5364–9 |doi=10.1523/JNEUROSCI.0890-04.2004 |pmc=6729305 |pmid=15190109 |doi-access=free |title-link=}}</ref> Icilin has been shown to be effective in the treatment of pruritus in an experimental model of itch.<ref name="pmid15740597">{{cite journal | last1 = Biró | first1 = T | last2 = Ko | first2 = MC | last3 = Bromm | first3 = B | last4 = Wei | first4 = ET | last5 = Bigliardi | first5 = P | last6 = Siebenhaar | first6 = F | last7 = Hashizume | first7 = H | last8 = Misery | first8 = L | last9 = Bergasa | first9 = NV | last10 = Kamei | first10 = C. | last11 = Schouenborg | first11 = J. | last12 = Roostermann | first12 = D. | last13 = Szabo | first13 = T. | last14 = Maurer | first14 = M. | last15 = Bigliardi-Qi | first15 = M. | last16 = Meingassner | first16 = J. G. | last17 = Hossen | first17 = M. A. | last18 = Schmelz | first18 = M. | last19 = Steinhoff | first19 = M. | title = How best to fight that nasty itch - from new insights into the neuroimmunological, neuroendocrine, and neurophysiological bases of pruritus to novel therapeutic approaches | journal = Experimental Dermatology | volume = 14 | issue = 3 | pages = 225–40 | year = 2005 | pmid = 15740597 | doi = 10.1111/j.0906-6705.2005.0321a.x | s2cid = 23665244 | display-authors = 3 | doi-access = free | hdl = 2437/149579 | hdl-access = free }}</ref> It is now used as a research tool for the study of TRP channels, although despite its high potency it is less selective for TRPM8 over other related ion channels than are other compounds such as WS-12.

== References == {{Reflist}}

== External links ==

{{Transient receptor potential channel modulators}}

Category:2-Hydroxyphenyl compounds Category:3-Nitrophenyl compounds Category:Ureas Category:Pyrimidones Category:Cooling flavors

{{Organic-compound-stub}}