{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 451447904 | Name = Hyperoside | ImageFile = Hyperoside.svg | ImageSize = 250px | ImageName = | IUPACName = 3-(β-<small>D</small>-Galactopyranosyloxy)-3′,4′,5,7-tetrahydroxyflavone | SystematicName = 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-{[(2''S'',3''R'',4''S'',5''R'',6''R'')-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4''H''-1-benzopyran-4-one | OtherNames= Hyperozide<br>Hyperasid<br>Hyperosid<br>Hyperin<br>quercetin galactoside<br>Quercetin-3-galactoside<br>Quercetin-3-''O''-galactoside |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 482-36-0 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 67486 | ChEMBL = 251254 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 4444962 | DrugBank = DB16403 | EC_number = 207-580-6 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = C10073 | PubChem = 5281643 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 8O1CR18L82 | SMILES = c1cc(c(cc1c2c(c(=O)c3c(cc(cc3o2)O)O)O[C@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO)O)O)O)O)O | InChI = 1/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17+,18-,21+/m1/s1 | InChIKey = OVSQVDMCBVZWGM-DTGCRPNFBG | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17+,18-,21+/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = OVSQVDMCBVZWGM-DTGCRPNFSA-N }} |Section2={{Chembox Properties | C=21 | H=20 | O=12 | Density = 1.879 g/mL | MeltingPt = | BoilingPt = }} }}
'''Hyperoside''' is a chemical compound. It is the 3-''O''-galactoside of quercetin.
== Natural occurrences == Hyperoside has been isolated from ''Drosera rotundifolia'', from the Lamiaceae ''Stachys sp.'' and ''Prunella vulgaris'', from ''Rumex acetosella'', ''Cuscuta chinensis'' seeds, from St John's wort and from ''Camptotheca acuminata''.<ref>{{cite journal | doi = 10.1021/jf0484780 | title = Antifungal Activity of Camptothecin, Trifolin, and Hyperoside Isolated from Camptotheca acuminata | year = 2005 | last1 = Li | first1 = Shiyou | last2 = Zhang | first2 = Zhizhen | last3 = Cain | first3 = Abigail | last4 = Wang | first4 = Bo | last5 = Long | first5 = Melissa | last6 = Taylor | first6 = Josephine | journal = Journal of Agricultural and Food Chemistry | volume = 53 | pages = 32–7 | pmid = 15631505 | issue = 1| bibcode = 2005JAFC...53...32L | url = https://scholarworks.sfasu.edu/cgi/viewcontent.cgi?article=1091&context=biology | url-access = subscription }}</ref> It is one of the phenolic compounds in the invasive plant ''Carpobrotus edulis'' and contributes to the antibacterial<ref>{{Cite journal|doi=10.1016/S0378-8741(01)00197-0|title=Purification and identification of active antibacterial components in Carpobrotus edulis L|year=2001|last1=Van Der Watt|first1=Elmarie|last2=Pretorius|first2=Johan C|journal=Journal of Ethnopharmacology|volume=76|pages=87–91|pmid=11378287|issue=1}}</ref> properties of the plant.
In ''Rheum nobile'' and ''R. rhaponticum'', it serves as a UV blocker found in the bracts.
It is also found in ''Geranium niveum''<ref>{{Cite journal|pmid=10346950|year=1999|last1=Calzada|first1=F|last2=Cerda-García-Rojas|first2=CM|last3=Meckes|first3=M|last4=Cedillo-Rivera|first4=R|last5=Bye|first5=R|last6=Mata|first6=R|title=Geranins a and B, new antiprotozoal A-type proanthocyanidins from Geranium niveum|volume=62|issue=5|pages=705–9|doi=10.1021/np980467b|journal=Journal of Natural Products}}</ref> and ''Taxillus kaempferi''.<ref name=Konishi>The constituents of Taxillus kaempferi and the host, Pinus thunbergii. I. Catechins and flavones of Taxillus kaempferi. Konishi T, Nishio T, Kiyosawa S, Fujiwara Y and Konoshima T, Yakugaku Zasshi., February 1996, volume 116, issue 2, pages 148-157 (article in Japanese)</ref>
==References== {{Reflist|2}}
{{Opioidergics}} {{Flavonol}}
Category:Quercetin glycosides Category:Flavonoid galactosides Category:Kappa-opioid receptor antagonists Category:Mu-opioid receptor antagonists Category:Chemicals in Hypericum