{{Chembox | ImageFile = Hydrindane.svg | ImageSize = | ImageAlt = | IUPACName = 2,3,3''a'',4,5,6,7,7a-octahydro-1H-indene | OtherNames = octahydroindene, hexahydroindane, bicyclo[4.3.0]nonane |Section1={{Chembox Identifiers | CASNo = 496-10-6 | CASNo_Ref = {{Cascite|correct|CAS}} | Beilstein = 2321743 | ChEBI = 49301 | ChemSpiderID = 9902 | EC_number = 207-813-1 | PubChem = 10325 | StdInChI=1S/C9H16/c1-2-5-9-7-3-6-8(9)4-1/h8-9H,1-7H2 | StdInChIKey = BNRNAKTVFSZAFA-UHFFFAOYSA-N | SMILES = C1CCC2CCCC2C1 }} |Section2={{Chembox Properties | C=9|H=16 | MolarMass = | RefractIndex = | Appearance = | Density = 0.90732 g/cm<sup>3</sup> | MeltingPtC = -53 | MeltingPt_notes = | BoilingPtC = 165.5-167.5 | BoilingPt_notes = | Solubility = }} |Section3={{Chembox Hazards | GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/10325#section=Safety-and-Hazards] | GHSPictograms = {{GHS02}}{{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|226|302|413}} | PPhrases = {{P-phrases|210|233|240|241|242|243|264|270|273|280|301+317|303+361+353|330|370+378|403+235|501}} | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Hydrindane''' is an organic compound with the formula {{chem2|C9H16}}. A bicyclic molecule, it is the hydrogenated derivative of the more common hydrocarbons indane and indene. Isomers of hydrindane include the compound with cis-fused rings and the chiral trans-fused derivative.<ref name="LNorman">{{citation|author=Norman L. Allinger, James L. Coke |date=1960 |doi=10.1021/ja01495a039 |issue=10 |pages=2553–2556 |periodical=Journal of the American Chemical Society |title=The Relative Stabilities of cis and trans Isomers. VII. The Hydrindanes 1,2 |volume=82 |bibcode=1960JAChS..82.2553A }}<!-- auto-translated from German by Module:CS1 translator --></ref>

==Occurrence== [[image:Lanostane.svg|left|Lanostane, one of many steroids with a hydrindane core.|thumb]] Hydrindane is a component of diesel fuels produced by hydrocracking.<ref>{{cite journal |last1=McVicker |first1=G. |title=Selective Ring Opening of Naphthenic Molecules |journal=Journal of Catalysis |date=2002 |volume=210 |issue=1 |pages=137–148 |doi=10.1006/jcat.2002.3685 |bibcode=2002JCat..210..137M }}</ref> Hydrindane is a subunit of many steroids.<ref name="HBeyer">{{citation|author=Hans Beyer, Wolfgang Walter |date=1978 |edition=18. |isbn=3-7776-0342-2 |location=Stuttgart |pages=350 |publisher=S. Hirzel Verlag |title=Lehrbuch der organischen Chemie}}<!-- auto-translated from German by Module:CS1 translator --></ref>

==References== <references />

Category:Bicycloalkanes *