{{short description|Chemical compound}} {{Chembox | ImageFile = Hernandezine.svg | ImageAlt = | IUPACName = | OtherNames = |Section1={{Chembox Identifiers | CASNo = 6681-13-6 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = HPH24MXX7G | PubChem = 72343 | ChemSpiderID = 65282 | SMILES = CN1CCc2cc(c3cc2[C@@H]1Cc4ccc(cc4)Oc5cc(ccc5OC)C[C@H]6c7c(c(c(c(c7O3)OC)OC)OC)CCN6C)OC | StdInChI = 1S/C39H44N2O7/c1-40-16-14-25-21-32(43-4)34-22-28(25)29(40)18-23-8-11-26(12-9-23)47-33-20-24(10-13-31(33)42-3)19-30-35-27(15-17-41(30)2)36(44-5)38(45-6)39(46-7)37(35)48-34/h8-13,20-22,29-30H,14-19H2,1-7H3/t29-,30-/m0/s1 | StdInChIKey = FUZMQNZACIFDBL-KYJUHHDHSA-N | ChEBI = 5677 | KEGG = C09461}} |Section2={{Chembox Properties | C=39 | H=44 | N=2 | O=7 | Formula = | MolarMass = | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Hernandezine''' is a tetrahydroquinoline alkaloid that has been isolated from ''Thalictrum''.<ref>{{Cite journal | pmid = 2284950 | year = 1990 | last1 = Xu | first1 = C. X. | title = Anti-tumor effect of hernandezine and other components extracted from Thalictrum glandulosissimum | journal = Yao Xue Xue Bao = Acta Pharmaceutica Sinica | volume = 25 | issue = 5 | pages = 330–5 | last2 = Lin | first2 = L. | last3 = Sun | first3 = R. H. | last4 = Liu | first4 = X. | last5 = Han | first5 = R. }}</ref>

==References== {{reflist}}

Category:Benzylisoquinoline alkaloids

{{alkaloid-stub}}