{{Short description|Chemical compound}} {{distinguish|haematein|Hemin}} {{More citations needed|date=December 2025}} {{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 449924799 | ImageFile=Hematin b.svg | ImageSize=300px | OtherNames= |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo=15489-90-4 | DrugBank = DB13387 | EC_number = 239-518-9 | PubChem=446067 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 16736140 | UNII = 0WP180G15G | SMILES = CC1C2CC3NC(CC4C(=C(C([N-]4)CC5NC(CC(C1CCC(=O)O)[N-]2)C(=C5C)CCC(=O)O)C)C=C)C(=C3C=C)C.[OH-].[Fe+3] | InChIKey = DVJHGZPPXLPYLP-UHFFFAOYSA-M | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C34H48N4O4.Fe.H2O/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;;/h7-8,20,24-32,36-37H,1-2,9-16H2,3-6H3,(H,39,40)(H,41,42);;1H2/q-2;+3;/p-1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = | MeSHName= }} |Section2={{Chembox Properties | C=34 | H=33 | Fe=1 | N=4 |O=5 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= insoluble in water, but soluble in alkaline water }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }} '''Haematin''' (also known as '''hematin''', '''ferriheme''', '''hematosin''', '''hydroxyhemin''', '''oxyheme''', '''phenodin''', or '''oxyhemochromogen''') is a dark bluish or brownish pigment containing iron in the ferric state, obtained by the oxidation of haem.
Haematin inhibits the synthesis of porphyrin (by repressing ALAS1 synthesis),<ref name=":0">{{Cite book |last=Rodwell |first=Victor W. |title=Harper's Illustrated Biochemistry |publisher=McGraw-Hill Education |year=2018 |isbn=978-1-25-983794-4 |edition=31st |pages=311}}</ref> and stimulates the synthesis of globin. For this reason, it is used in the treatment of porphyrias.<ref name=":0" />
It is a component of cytochromes and peroxidases. Haematin derived synthetically from hemin is used as a reagent.
== References == {{reflist}}
Category:Iron(III) compounds Category:Pigments
{{organic-compound-stub}}