{{chembox | ImageFile = Gymnopusin.svg | ImageCaption = Chemical structure of gymnopusin | PIN = 3,4,9-Trimethoxyphenanthrene-2,7-diol | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 113476-61-2 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = U8AQ3SG7TD | PubChem = 14505894 | ChEMBL = 2208383 | ChEBI_Ref = | ChEBI = | KEGG_Ref = | KEGG = | ChemSpiderID = 28648972 | SMILES = COC1=CC2=CC(=C(C(=C2C3=C1C=C(C=C3)O)OC)OC)O | InChI = 1/C17H16O5/c1-20-14-7-9-6-13(19)16(21-2)17(22-3)15(9)11-5-4-10(18)8-12(11)14/h4-8,18-19H,1-3H3 | InChIKey = GIVSZLKTIBWYRM-UHFFFAOYAJ | StdInChI = 1S/C17H16O5/c1-20-14-7-9-6-13(19)16(21-2)17(22-3)15(9)11-5-4-10(18)8-12(11)14/h4-8,18-19H,1-3H3 | StdInChIKey = GIVSZLKTIBWYRM-UHFFFAOYSA-N | RTECS = | MeSHName = }} |Section2={{Chembox Properties | C=17 | H=16 | O=5 | Appearance = | Density = | MeltingPtC = | BoilingPtC = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPtC = | AutoignitionPt = }} }}
'''Gymnopusin''' is a phenanthrenediol produced by the orchid ''Bulbophyllum gymnopus''.<ref>{{cite journal | last1 = Hughes | first1 = Andrew B. | last2 = Sargent | first2 = Melvyn V. | year = 1989 | title = Structure and synthesis of gymnopusin, a novel phenanthrenediol from the orchid Bulbophyllum gymnopus | url = | journal = J. Chem. Soc. Perkin Trans. | volume = 1 | issue = | pages = 1787–1791 | doi = 10.1039/P19890001787 }}</ref> It is also found in ''Bulbophyllum reptans''<ref>Kovacs, Phytochemistry, 69, (2008), 1084</ref> and ''Maxillaria densa''.<ref>{{cite journal | last1 = Valencia-Islas | first1 = NA | last2 = Paul | first2 = RN | last3 = Shier | first3 = WT | last4 = Mata | first4 = R | last5 = Abbas | first5 = HK | year = 2002 | title = Phytotoxicity and ultrastructural effects of gymnopusin from the orchid Maxillaria densa on duckweed (Lemna pausicostata) frond and root tissues | url = | journal = Phytochemistry | volume = 61 | issue = 2| pages = 141–148 | doi = 10.1016/S0031-9422(02)00220-0 | pmid = 12169307 }}</ref>
== References == {{reflist}}
== External links == * [http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00015902 Gymnopusin at kanaya.naist.jp/knapsack_jsp]
{{Phenanthrenes}}
Category:Phenanthrenoids Category:Orchids
{{aromatic-stub}}