{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477396557 | ImageFile = Glabridin.svg | ImageClass = skin-invert-image | IUPACName = (3''R'')-6′′,6′′-Dimethyl-6′′''H''-pyrano[2′′,3′′:7,8]isoflavan-2′,4′-diol | SystematicName = 4-[(3''R'')-8,8-Dimethyl-3,4-dihydro-2''H'',8''H''-(benzo[1,2-''b'':3,4-''b''′]dipyran)-3-yl]benzene-1,3-diol | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 59870-68-7 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = HOC5567T41 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 480477 | PubChem = 124052 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 110560 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 5369 | SMILES = O4c2c1\C=C/C(Oc1ccc2C[C@H](c3ccc(O)cc3O)C4)(C)C | InChI = 1/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 | InChIKey = LBQIJVLKGVZRIW-ZDUSSCGKBA | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = LBQIJVLKGVZRIW-ZDUSSCGKSA-N }} |Section2={{Chembox Properties | C=20 | H=20 | O=4 | Appearance = Yellowish-brown powder | Density = | MeltingPtC = 238-240 | MeltingPt_ref = <ref>SciFinder Record for CAS#59870-68-7</ref> | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Glabridin''' is a chemical compound that is found in the root extract of licorice (''Glycyrrhiza glabra'').<ref>{{Cite journal | vauthors = Kinoshita T, Kajiyama K, Hiraga Y, Takahashi K, Tamura Y, Mizutani K | journal = Heterocycles | title = Isoflavan derivatives from Glycyrrhiza glabra (licorice) | date = 1996 | volume = 43 | issue = 3 | pages = 581–588}}</ref> Glabridin is an isoflavane, a type of isoflavonoid. This product is part of a larger family of plant-derived molecules, the natural phenols. Glabridin effectively inhibits platelet activation, so it might become therapeutic agent for thromboembolic disorders.<ref name="pmid">{{cite journal | vauthors = Chung CL, Chen JH, Huang WC, Sheu JR, Hsia CW, Jayakumar T, Hsia CH, Chiou KR, Hou SM | title = Glabridin, a Bioactive Flavonoid from Licorice, Effectively Inhibits Platelet Activation in Humans and Mice | journal = International Journal of Molecular Sciences | volume = 23 | issue = 19 | date = September 2022 | article-number = 11372 | pmid = 36232674| pmc = 9570097 | doi = 10.3390/ijms231911372 | doi-access = free }}{{Creative Commons text attribution notice|cc=by4|from this source=yes}}</ref>
It is used as an ingredient in cosmetics and is listed in International Nomenclature of Cosmetic Ingredients (INCI).
Glabridin is yellowish-brown powder. It is insoluble in water, but soluble in organic solvents such as propylene glycol.
==See also== * Glabrene * Isoliquiritigenin * Liquiritigenin
==References== <references />
{{Isoflavane}}
Category:Isoflavanes