{{Chembox | ImageFile = Germacrone structure.svg | ImageSize = 200px | ImageAlt = | PIN = (3''E'',7''E'')-3,7-Dimethyl-10-(propan-2-ylidene)cyclodeca-3,7-dien-1-one | OtherNames = |Section1={{Chembox Identifiers | CASNo = 6902-91-6 | ChEBI = 80830 | ChemSpiderID = 4940991 | EC_number = 834-535-3 | KEGG = C16966 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = E2WQ6N4FBP | PubChem = 6436348 | InChI=1S/C15H22O/c1-11(2)14-9-8-12(3)6-5-7-13(4)10-15(14)16/h7-8H,5-6,9-10H2,1-4H3/b12-8+,13-7+ | InChIKey= CAULGCQHVOVVRN-SWZPTJTJSA-N | SMILES =C/C/1=C\CC(=C(C)C)C(=O)C/C(=C/CC1)/C }} |Section2={{Chembox Properties | C=15 | H=22 | O=1 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = flammable | FlashPt = | AutoignitionPt = }} }}
'''Germacrone''' is a sesquiterpene which has been isolated via distillation from the plant species ''Geranium macrorrhizum''.<ref>{{cite journal | journal = Chemistry & Biodiversity| date = 2010 | volume = 7 | issue = 11 | pages = 2783–800 | doi = 10.1002/cbdv.201000100 | title = Geranium macrorrhizum L. (Geraniaceae) essential oil: a potent agent against Bacillus subtilis | pmid = 21072778 | s2cid = 7366166 | last1 = Radulović | first1 = Niko S. | last2 = Dekić | first2 = Milan S. | last3 = Stojanović-Radić | first3 = Zorica Z. | last4 = Zoranić | first4 = Suad K. }}</ref> It has shown antiviral properties in an animal model of influenza infection.<ref name=Liao>{{cite journal |pmid=24095670 |year=2013 |last1=Liao |first1=Q |last2=Qian |first2=Z |last3=Liu |first3=R |last4=An |first4=L |last5=Chen |first5=X |title=Germacrone inhibits early stages of influenza virus infection |doi=10.1016/j.antiviral.2013.09.021 |journal=Antiviral Research |volume=100 |issue=3 |pages=578–88}}</ref>
==References== {{reflist}}
{{organic-compound-stub}}
Category:Sesquiterpenes Category:Ten-membered rings Category:Cyclic ketones