{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | drug_name = | image = Garsorasib.svg | image_class = skin-invert-image | width = 200px | caption =
<!-- Clinical data --> | pronounce = | tradename = 安方宁 | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = | class = | ATC_prefix = | ATC_suffix =
<!-- Legal status --> | legal_status = Rx in China
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =
<!-- Identifiers --> | CAS_number = 2559761-14-5 | PubChem = 155332312 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 115010420 | UNII = P491NE9G6Z | KEGG = | ChEBI = | ChEMBL = 5095066 | NIAID_ChemDB = | PDB_ligand = | synonyms = D-1553
<!-- Chemical data --> | IUPAC_name = 7-(2-Amino-6-fluorophenyl)-1-(4,6-dicyclopropylpyrimidin-5-yl)-4-[(2''S'',5''R'')-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-6-fluoropyrido[2,3-''d'']pyrimidin-2-one | C=32 | H=32 | F=2 | N=8 | O=2 | SMILES = C[C@@H]1CN([C@H](CN1C(=O)C=C)C)C2=NC(=O)N(C3=NC(=C(C=C32)F)C4=C(C=CC=C4F)N)C5=C(N=CN=C5C6CC6)C7CC7 | StdInChI = 1S/C32H32F2N8O2/c1-4-24(43)40-13-17(3)41(14-16(40)2)30-20-12-22(34)28(25-21(33)6-5-7-23(25)35)38-31(20)42(32(44)39-30)29-26(18-8-9-18)36-15-37-27(29)19-10-11-19/h4-7,12,15-19H,1,8-11,13-14,35H2,2-3H3/t16-,17+/m1/s1 | StdInChIKey = DKFRWZJCNPETGI-SJORKVTESA-N }}
'''Garsorasib''' is a pharmaceutical drug used for cancer treatment. It is a selective inhibitor of the enzyme KRAS that has the G12C mutation.<ref>{{cite journal | vauthors = Ruan DY, Wu HX, Xu Y, Munster PN, Deng Y, Richardson G, Yan D, Lee MA, Lee KW, Pan H, Hager S, Li X, Wei S, Hou X, Underhill C, Millward M, Nordman I, Zhang J, Shan J, Han G, Grewal J, Gadgeel SM, Sanborn RE, Huh SJ, Hu X, Zhang Y, Xiang Z, Luo L, Xie X, Shi Z, Wang Y, Zhang L, Wang F, Xu RH | title = Garsorasib, a KRAS G12C inhibitor, with or without cetuximab, an EGFR antibody, in colorectal cancer cohorts of a phase II trial in advanced solid tumors with KRAS G12C mutation | journal = Signal Transduction and Targeted Therapy | volume = 10 | issue = 1 | date = June 2025 | pmid = 40523897 | pmc = 12170901 | doi = 10.1038/s41392-025-02274-z | article-number = 189 }}</ref><ref>{{cite journal | vauthors = Li Z, Dang X, Huang D, Jin S, Li W, Shi J, Wang X, Zhang Y, Song Z, Zhang J, Zhuang W, Liu X, Jiang L, Meng X, Zhao M, Zhou J, Zhang L, Wang P, Luo H, Yang J, Cang S, Wang X, Zhang L, Lu S | title = Garsorasib in patients with KRAS<sup>G12C</sup>-mutated non-small-cell lung cancer in China: an open-label, multicentre, single-arm, phase 2 trial | journal = The Lancet. Respiratory Medicine | volume = 12 | issue = 8 | pages = 589–598 | date = August 2024 | pmid = 38870979 | doi = 10.1016/S2213-2600(24)00110-3 }}</ref>
In China, it is approved for the treatment of advanced non-small cell lung cancer (NSCLC) carrying the KRAS G12C mutation in patients who have received at least one systemic treatment.<ref>{{cite web | title = Garsorasib Tablets Approved with Conditions for Marketing by China NMPA | date = 2025-02-19 | url = https://english.nmpa.gov.cn/2025-02/19/c_1073662.htm | publisher = National Medical Products Administration }}</ref>
== References == {{reflist}}
{{antineoplastic-drug-stub}}
Category:Enzyme inhibitors Category:Acrylamides Category:Cyclopropyl compounds Category:Fluoroarenes Category:Piperazines Category:Pyrimidines Category:Pyrazines Category:Anilines Category:Pyridopyrimidines