{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 442713318 | ImageFile = Gamendazole.svg | ImageClass = skin-invert-image | ImageFile2 = Gamendazole ball-and-stick model.png | ImageClass2 = bg-transparent | ImageSize = 200px | ImageAlt = | PIN = (2''E'')-3-<nowiki/>{1-[(2,4-Dichlorophenyl)methyl]-6-(trifluoromethyl)-1''H''-indazol-3-yl}prop-2-enoic acid | OtherNames = ''trans''-3-(1-Benzyl-6-(trifluoromethyl)-1''H''-indazol-3-yl)acrylic acid) |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 877766-45-5 | CASNo1_Ref = {{cascite|correct|CAS}} | CASNo1 = 877773-32-5 | CASNo1_Comment = (non-specific) | UNII_Ref = {{fdacite|correct|FDA}} | UNII = X75Z3RSN5M | PubChem = 11212172 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 90703 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 9387234 | SMILES = FC(F)(F)c1ccc2c(c1)n(nc2\C=C\C(=O)O)Cc3ccc(Cl)cc3Cl | InChI = 1/C18H11Cl2F3N2O2/c19-12-3-1-10(14(20)8-12)9-25-16-7-11(18(21,22)23)2-4-13(16)15(24-25)5-6-17(26)27/h1-8H,9H2,(H,26,27)/b6-5+ | InChIKey = KYYQMVUKYQCSQY-AATRIKPKBM | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C18H11Cl2F3N2O2/c19-12-3-1-10(14(20)8-12)9-25-16-7-11(18(21,22)23)2-4-13(16)15(24-25)5-6-17(26)27/h1-8H,9H2,(H,26,27)/b6-5+ | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = KYYQMVUKYQCSQY-AATRIKPKSA-N}} |Section2={{Chembox Properties | C=18 | H=11 | Cl=2 | F=3 | N=2 | O=2 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Gamendazole''' is a drug candidate for male contraception. It is an indazole carboxylic acid derived from lonidamine (LND). It has been shown to reduce fertility in male rats without affecting testosterone levels, but human clinical trials have not been started.<ref>{{cite web | url = https://pipeline.ctiexchange.org/products/h2-gamendazole | title = H2-Gamendazole | work = Calliope: The Contraceptive Pipeline Database | quote = Project Phase: Early Development, Project Stage: Pre-clinical | access-date = 2017-09-15 | archive-date = 2017-09-16 | archive-url = https://web.archive.org/web/20170916094518/https://pipeline.ctiexchange.org/products/h2-gamendazole | url-status = dead }}</ref>

==Rat studies== Gamendazole produced 100% antispermatogenic effects at 25&nbsp;mg/kg i.p. in rats, whereas 200&nbsp;mg/kg was fatal for 60% of rats tested. Since gamendazole produced 100% efficacy, it was tested orally. At a dose of 6&nbsp;mg/kg, 100% of rats were infertile 4 weeks after a single administration. Complete infertility was maintained for 2 weeks, followed by complete recovery in 4 of 7 rats. The other 3 never recovered fertility. Upon dosing 6&nbsp;mg/kg orally for 7 days, it produced similar infertility results, but only 2 of 7 rats recovered fertility. There were no abnormalities in rates of conception or abnormal conception in rats who recovered fertility.<ref name=Tash>{{cite journal|last=Tash|first=Joseph|title=A Novel Potent Indazole Carboxylic Acid Derivative Blocks Spermatogenesis and Is Contraceptive in Rats after a Single Oral Dose|journal=Biology of Reproduction|date=July 2008|volume=78|issue=6|pages=1127–1138|doi=10.1095/biolreprod.106.057810|pmid=18218612|doi-access=}}<!--|accessdate=31 July 2011--></ref>

Pathology reports were conducted on gamendazole treated rats. At 25&nbsp;mg/kg i.p., 6&nbsp;mg/kg oral, and in animals that survived 200&nbsp;mg/kg i.p., there were no remarkable findings, with no evidence of inflammation, necrosis, tumors, or hemorrhage. There was also a lack of observable behavioral effects at 25&nbsp;mg/kg i.p., 6&nbsp;mg/kg oral, and in animals that survived 200&nbsp;mg/kg i.p. Gamendazole treatment had no effect on testosterone levels, and was reported to affect Sertoli cell function, leading to decreased levels of inhibin B. Low levels of inhibin B were correlated to the infertility of the rat.<ref name=Tash />

==References== {{Reflist}}

Category:Contraception for males Category:Experimental methods of birth control Category:Indazoles Category:Carboxylic acids Category:Trifluoromethyl compounds Category:Chlorobenzene derivatives