{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443831933 | ImageFile=Dulcitol.svg | ImageFile2=D-Galactitol.png | ImageSize= | IUPACName=<small>D</small>-Galactitol |SystematicName=(2''R'',3''S'',4''R'',5''S'')-hexane-1,2,3,4,5,6-hexol | OtherNames=Dulcitol |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 11357 | InChI = 1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6- | InChIKey = FBPFZTCFMRRESA-GUCUJZIJBM | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6- | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = FBPFZTCFMRRESA-GUCUJZIJSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo=608-66-2 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 113ZQ1Y7DD | PubChem=11850 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1773904 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 16813 | SMILES = O[C@H]([C@@H](O)CO)[C@@H](O)[C@H](O)CO }} |Section2={{Chembox Properties | C=6 | H=14 | O=6 | MolarMass=182.172 g/mol | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= | MagSus = −112.40·10<sup>−6</sup> cm<sup>3</sup>/mol }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}
'''Galactitol''' ('''dulcitol''') is a sugar alcohol, the reduction product of galactose.<ref name=pubchem>{{cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/11850|title=Galactitol - Compound Summary |publisher=National Center for Biotechnology Information|access-date=2008-08-06}}</ref> It has a slightly sweet taste.<ref name=pubchem/> In people with galactokinase deficiency, a form of galactosemia, excess dulcitol forms in the lens of the eye leading to cataracts.<ref name=eMedicine>{{cite web |url = http://www.emedicine.com/ped/TOPIC815.HTM |title = Galactokinase Deficiency |access-date = 2008-08-08 |author = Roth, KS |date = September 10, 2007 |work = eMedicine |publisher = WebMD}}</ref>
Galactitol is produced from galactose in a reaction catalyzed by aldose reductase.<ref>{{Cite journal |last=Narayanan |first=S. |date=1993-03-01 |title=Aldose reductase and its inhibition in the control of diabetic complications |url=http://www.annclinlabsci.org/content/23/2/148 |journal=Annals of Clinical & Laboratory Science |language=en |volume=23 |issue=2 |pages=148–158 |issn=0091-7370 |pmid=8457142}}</ref>
The other common galactose metabolism defect is a defect in galactose-1-phosphate uridylyltransferase, an autosomal recessive disorder, which also causes a buildup of galactitol as a result of increased concentrations of galactose-1-phosphate and galactose. This disorder leads to cataracts caused by galactitol buildup.<ref>{{Cite journal |last=Palmieri |first=Michael |last2=Mazur |first2=Alice |last3=Berry |first3=Gerard T. |last4=Ning |first4=Cong |last5=Wehrli |first5=Suzanne |last6=Yager |first6=Claire |last7=Reynolds |first7=Robert |last8=Singh |first8=Rani |last9=Muralidharan |first9=Kasinathan |last10=Langley |first10=Sharon |last11=Elsas |first11=Louis |last12=Segal |first12=Stanton |date=1999-10-01 |title=Urine and plasma galactitol in patients with galactose-1-phosphate uridyltransferase deficiency galactosemia |url=https://www.sciencedirect.com/science/article/pii/S0026049599902718 |journal=Metabolism |volume=48 |issue=10 |pages=1294–1302 |doi=10.1016/S0026-0495(99)90271-8 |issn=0026-0495|url-access=subscription }}</ref>
==References== {{reflist}}
==External links== *{{Commonscatinline}}
{{Alcohols}} {{Fructose and galactose metabolic intermediates}}
Category:Sugar alcohols Category:Sugar substitutes