{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 436706508 | ImageFile = Fructone.svg | ImageAlt = Skeletal formula of fructone | ImageFile1 = Fructone-3D-balls.png | ImageSize1 = 160 | ImageAlt1 = Ball-and-stick model of the fructone molecule | PIN = Ethyl (2-methyl-1,3-dioxolan-2-yl)acetate | OtherNames = Ethyl 2-(2-methyl-1,3-dioxolan-2-yl)acetate |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 6413-10-1 | PubChem = 80865 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 72995 | SMILES = CC1(OCCO1)CC(OCC)=O | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C8H14O4/c1-3-10-7(9)6-8(2)11-4-5-12-8/h3-6H2,1-2H3 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = XWEOGMYZFCHQNT-UHFFFAOYSA-N <!--| InChI = InChI=1/C8H14O4/c1-3-10-7(9)6-8(2)11-4-5-12-8/h3-6H2,1-2H3/i1-12,2-12,3-12,4-12,5-12,6-12,7-12,8-12,9-16,10-16,11-16,12-16--> | EINECS =229-114-0 | UNII_Ref = {{fdacite|changed|FDA}} | UNII = G5EXI4NID0 }} |Section2={{Chembox Properties | Formula = C<sub>8</sub>H<sub>14</sub>O<sub>4</sub> | MolarMass = 174.19 | Appearance = Clear liquid | Density = 1.067{{nbsp}}g/cm<sup>3</sup> <sup>(1)</sup> | MeltingPt = | BoilingPt = 207.99 (760{{nbsp}}mmHg) | Solubility = 1.893{{nbsp}}g/L }} |Section3={{Chembox Hazards | MainHazards = | FlashPtC = 97 | AutoignitionPtC = }} }}

'''Fructone''' is the organic compound with the formula {{chem2|CH3C(O2C2H4)CH2CO2C2H5}} It is the ketal derived from the condensation of ethyl acetoacetate and ethylene glycol. Also known as '''apple ketal''' and '''applinal''', it has a fruity, apple-like smell with pineapple, strawberry, and woody aspects reminiscent of pine trees (described as "sweet, fruity, apple, green, tropical, plum, woody").<ref>{{cite web |title=apple ketal|url=https://scentsandflavors.com/database/9dbb5134-74e3-468e-ae3a-64b41d0d9104|website=Scents and Flavors |publisher=Scents and Flavors |access-date=1 April 2026}}</ref> It is a commercial fragrance.<ref>{{cite book |doi=10.1002/14356007.t11_t02 |chapter=Flavors and Fragrances, 3. Aromatic and Heterocyclic Compounds |title=Ullmann's Encyclopedia of Industrial Chemistry |date=2016 |last1=Panten |first1=Johannes |last2=Surburg |first2=Horst |pages=1–45 |isbn=978-3-527-30673-2 }}</ref>

== External links == * [http://www.iff.co.th/Ingredients.nsf/0/07B538A011C249B18025699300363143 Fructone product page]{{Dead link|date=December 2019 |bot=InternetArchiveBot |fix-attempted=yes }} IFF * [https://scentsandflavors.com/database/9dbb5134-74e3-468e-ae3a-64b41d0d9104 Extensive data page]

==References== <references />

Category:Flavors Category:Dioxolanes Category:Carboxylate esters Category:Sweet-smelling chemicals Category: Perfume ingredients Category:Ethyl esters