{{Short description|Chemical compound}} {{Distinguish|Fluclorolone|Fluocortin}} {{Drugbox | Verifiedfields = changed | verifiedrevid = 461101617 | IUPAC_name = (1''S'',2''R'',8''S'',10''S'',11''S'',13''R'',14''S'',15''S'',17''S'')-8-fluoro-17-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyltetracyclo[8.7.0.0<sup>2,7</sup>.0<sup>11,15</sup>]heptadeca-3,6-dien-5-one | image = Fluocortolone skeletal.svg | image_class = skin-invert-image
<!--Clinical data--> | tradename = | Drugs.com = | pregnancy_category = | legal_status = | routes_of_administration = Ointment, suppositories
<!--Pharmacokinetic data--> | bioavailability = | metabolism = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|changed|??}} | CAS_number = 152-97-6 | ATC_prefix = C05 | ATC_suffix = AA08 | ATC_supplemental = {{ATC|D07|AC05}} {{ATC|H02|AB03}} | PubChem = 9053 | DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank = DB08971 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 8701 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 65VXC1MH0J | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D04218 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 251634
<!--Chemical data--> | C=22 | H=29 | F=1 | O=4 | smiles = O=C\1\C=C/[C@]4(/C(=C/1)[C@@H](F)C[C@@H]2[C@@H]4[C@@H](O)C[C@@]3([C@@H](C(=O)CO)[C@@H](C[C@@H]23)C)C)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C22H29FO4/c1-11-6-14-13-8-16(23)15-7-12(25)4-5-21(15,2)20(13)17(26)9-22(14,3)19(11)18(27)10-24/h4-5,7,11,13-14,16-17,19-20,24,26H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19-,20-,21+,22+/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = GAKMQHDJQHZUTJ-ULHLPKEOSA-N | synonyms = <small>(6''S'',8''S'',9''R'',10''S'',11''S'',13''S'',14''S'',16''R'',17''S'')-6-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[''a'']phenanthren-3-one</small> }}
'''Fluocortolone''' is a glucocorticoid<ref name="pmid6054003">{{cite journal | vauthors = Munro DD, Wilson HT, Rhodes EL | title = Comparison of betamethasone 17-valerate ointment with fluocortolone and fluocortolone caproate ointment | journal = British Medical Journal | volume = 4 | issue = 5574 | pages = 275–6 | date = November 1967 | pmid = 6054003 | pmc = 1748932 | doi = 10.1136/bmj.4.5574.275 }}</ref> used in the treatment of several conditions, including hemorrhoids.
It is similar to fluocortin, but with one less carbonyl group.
==See also== * Corticosteroids
==References== {{Reflist}}
{{Glucocorticoids}} {{Vasoprotectives}} {{Glucocorticoidics}}
Category:Glucocorticoids Category:Organofluorides
{{systemic-hormonal-drug-stub}} {{cardiovascular-drug-stub}} {{dermatologic-drug-stub}}