{{Short description|Chemical compound}} {{Redirect-distinguish|Vanos|VANOS|VanossGaming}} {{Use dmy dates|date=January 2024}} {{cs1 config |name-list-style=vanc |display-authors=6}} {{Drugbox | Watchedfields = changed | verifiedrevid = 461101571 | image = Fluocinonide.png | image_class = skin-invert-image | alt =
<!--Clinical data--> | tradename = Fluonex, Lidex, others<ref>{{cite web | url = https://www.medlineplus.gov/druginfo/meds/a601054.html | work = MedlinePlus Drug Information | title = Fluocinonide Topical | publisher = U.S. National Library of Medicine }}</ref> | Drugs.com = {{drugs.com|CONS|fluocinonide}} | MedlinePlus = a601054 | pregnancy_category = | routes_of_administration = Topical | ATC_prefix = C05 | ATC_suffix = AA11 | ATC_supplemental = {{ATC|D07|AC08}}, {{ATCvet|C05|AA11}}, {{ATCvet|D07|AC08}}
| legal_AU = S4 | legal_UK = POM | legal_US = Rx-only | legal_status =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = Liver | elimination_half-life =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 356-12-7 | PubChem = 9642 | IUPHAR_ligand = 7078 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB01047 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 9265 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2W4A77YPAN | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D00325 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 1501
<!--Chemical data--> | IUPAC_name = 6α,9-difluoro-11β,16α,17,21-tetrahydroxypregna-1,4-diene-3,20-dione, cyclic 16,17-acetal with acetone,21-acetate | C=26 | H=32 | F=2 | O=7 | smiles = O=C(OCC(=O)[C@]45OC(O[C@@H]5C[C@@H]2[C@@]4(C[C@H](O)[C@]3(F)[C@]/1(/C=C\C(=O)\C=C\1[C@@H](F)C[C@@H]23)C)C)(C)C)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C26H32F2O7/c1-13(29)33-12-20(32)26-21(34-22(2,3)35-26)10-15-16-9-18(27)17-8-14(30)6-7-23(17,4)25(16,28)19(31)11-24(15,26)5/h6-8,15-16,18-19,21,31H,9-12H2,1-5H3/t15-,16-,18-,19-,21+,23-,24-,25-,26+/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = WJOHZNCJWYWUJD-IUGZLZTKSA-N }}
'''Fluocinonide''' is a potent glucocorticoid used topically as an anti-inflammatory agent for the treatment of skin disorders such as eczema and seborrhoeic dermatitis.<ref name=":1">{{Cite web |title=Fluocinonide Topical: MedlinePlus Drug Information |url=https://medlineplus.gov/druginfo/meds/a601054.html |access-date=16 November 2022 |website=medlineplus.gov |language=en}}</ref> It relieves itching, redness, dryness, crusting, scaling, inflammation, and discomfort.<ref name=":1" />
A common potential adverse effect is skin atrophy (thinning of the skin).<ref name=":0">{{cite journal | vauthors = Jablonska S, Groniowska M, Dabroswki J | title = Comparative evaluation of skin atrophy in man induced by topical corticoids | journal = The British Journal of Dermatology | volume = 100 | issue = 2 | pages = 193–206 | date = February 1979 | pmid = 154921 | doi = 10.1111/j.1365-2133.1979.tb05561.x | s2cid = 30656827 }}</ref>
In 2022, it was the 266th most commonly prescribed medication in the United States, with more than 1{{nbsp}}million prescriptions.<ref>{{cite web | title=The Top 300 of 2022 | url=https://clincalc.com/DrugStats/Top300Drugs.aspx | website=ClinCalc | access-date=30 August 2024 | archive-date=30 August 2024 | archive-url=https://web.archive.org/web/20240830202410/https://clincalc.com/DrugStats/Top300Drugs.aspx | url-status=live }}</ref><ref>{{cite web | title = Fluocinonide Drug Usage Statistics, United States, 2013 - 2022 | website = ClinCalc | url = https://clincalc.com/DrugStats/Drugs/Fluocinonide | access-date = 30 August 2024 }}</ref>
== Veterinary uses == Fluocinonide is used in veterinary medicine. It is a treatment for allergies in dogs.<ref>{{cite report | title = Dog Allergies <!-- | url = https://www.squidoo.com/dogallergy | archive-url = https://web.archive.org/web/20120607075556/http://www.squidoo.com/dogallergy | archive-date = 7 June 2012 --> | work = Squidoo }}</ref> Natural systemic cortisol concentrations can be suppressed for weeks after one week of topical exposure.<ref>{{cite journal | vauthors = Zenoble RD, Kemppainen RJ | title = Adrenocortical suppression by topically applied corticosteroids in healthy dogs | journal = Journal of the American Veterinary Medical Association | volume = 191 | issue = 6 | pages = 685–688 | date = September 1987 | doi = 10.2460/javma.1987.191.06.685 | pmid = 2824410 }}</ref>
== References == {{Reflist}}
{{Glucocorticoids}} {{Vasoprotectives}} {{Glucocorticoidics}} {{Portal bar | Medicine}} {{Authority control}}
Category:Acetate esters Category:Acetonides Category:Cyclohexanols Category:Corticosteroid cyclic ketals Category:Corticosteroid esters Category:Organofluorides Category:Glucocorticoids Category:Pregnanes Category:Diketones Category:Enones Category:Fluorinated corticosteroids