{{Chembox | ImageFile = Flavon num.svg | ImageSize = 220px | ImageClass = skin-invert | IUPACName = Flavone<ref>https://iupac.qmul.ac.uk/flavonoid/index.html#Flv321</ref> | OtherNames = | SystematicName = 2-Phenyl-4''H''-1-benzopyran-4-one<br> 2-Phenyl-4''H''-chromen-4-one | Section1 = {{Chembox Identifiers | CASNo = 525-82-6 | CASNo_Ref = {{Cascite|correct|CAS}} | Beilstein = 157598 | ChEBI = 42491 | ChEMBL = 275638 | ChemSpiderID = 10230 | DrugBank = DB07776 | EC_number = 208-383-8 | Gmelin = 1224858 | IUPHAR_ligand = 409 | KEGG = C15608 | PubChem = 10680 | RTECS = DJ3100630 | UNII = S2V45N7G3B | StdInChI=1S/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H | StdInChIKey = VHBFFQKBGNRLFZ-UHFFFAOYSA-N | SMILES = C1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3O2 }} | Section2 = {{Chembox Properties | C = 15|O=2|H=10 | MolarMass = | Appearance = white solid | Density = | MeltingPtC = 96-97 | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Flavone''' is an organic compound with the formula {{chem2|C6H4OC3H(Ph)O}}. A white solid, flavone is a derivative of chromone with a phenyl (Ph) substituent adjacent to the ether group. The compound is of little direct practical importance, but substituted derivatives, the flavones and flavonoids are a large class of nutritionally important natural products.<ref>{{cite journal |doi=10.1021/cr400265z|title=Chromone: A Valid Scaffold in Medicinal Chemistry |year=2014 |last1=Gaspar |first1=Alexandra |last2=Matos |first2=Maria João |last3=Garrido |first3=Jorge |last4=Uriarte |first4=Eugenio |last5=Borges |first5=Fernanda |journal=Chemical Reviews |volume=114 |issue=9 |pages=4960–4992 |url=https://repositorio-aberto.up.pt/handle/10216/70808 |url-access=subscription }}</ref> Flavone can be prepared in the laboratory by cyclization of 2-hydroxacetophenone.<ref>{{cite journal |doi=10.15227/orgsyn.032.0072|title=Flavone |journal=Organic Syntheses |year=1952 |volume=32 |page=72|author=T. S. Wheeler }}</ref> Isomeric with flavone is isoflavone, where the phenyl group is adjacent to the ketone.
==References== <references />
{{Flavones}}
Category:Flavones