Festuclavine

{{Chembox | ImageFile = Festuclavine.svg | ImageClass = skin-invert-image | ImageSize = 150px | ImageAlt = | IUPACName = 6,8β-Dimethylergoline | SystematicName = (6a''R'',9''R'',10a''R'')-7,9-Dimethyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-''fg'']quinoline | OtherNames = |Section1={{Chembox Identifiers | CASNo = 436-41-9 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GLS7Y869AV | PubChem = 332915 | ChemSpiderID = 294963 | SMILES = C[C@@H]1C[C@@H]2c3cccc4c3c(c[nH]4)C[C@H]2N(C1)C | StdInChI = 1S/C16H20N2/c1-10-6-13-12-4-3-5-14-16(12)11(8-17-14)7-15(13)18(2)9-10/h3-5,8,10,13,15,17H,6-7,9H2,1-2H3/t10-,13-,15-/m1/s1 | StdInChIKey = VLMZMRDOMOGGFA-WDBKCZKBSA-N}} |Section2={{Chembox Properties | C=16 | H=20 | N=2 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Festuclavine''' is an ergoline fungal isolate.<ref>{{Cite journal | pmid = 20526482 | year = 2010 | last1 = Wallwey | first1 = C | last2 = Matuschek | first2 = M | last3 = Xie | first3 = XL | last4 = Li | first4 = SM | title = Ergot alkaloid biosynthesis in Aspergillus fumigatus: Conversion of chanoclavine-I aldehyde to festuclavine by the festuclavine synthase FgaFS in the presence of the old yellow enzyme FgaOx3 | volume = 8 | issue = 15 | pages = 3500–8 | doi = 10.1039/c003823g | journal = Organic & Biomolecular Chemistry}}</ref>

==See also== * Festuclavine dehydrogenase

==Notes== {{reflist}}

Category:Alkaloids found in fungi Category:Clavines