{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = 1,3,7-trimethyl-8-({2-[methyl(1-phenylpropan-2-yl)amino]ethyl}amino)-3,7-dihydro-1''H''-purine-2,6-dione | image = Fencamine.png | image_class = skin-invert-image
<!--Clinical data--> | tradename = Altimina, Sicoclor | pregnancy_category = | legal_status = Rx-only | routes_of_administration = Oral | class = Stimulant
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | onset = | elimination_half-life = | duration_of_action = | excretion =
<!--Identifiers--> | CAS_number = 28947-50-4 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 3AO7AC8C6K | ATC_prefix = none | ATC_suffix = | PubChem = 115374 | ChemSpiderID = 103208 | synonyms = Methamphetaminoethylcaffeine
<!--Chemical data--> | C=20 | H=28 | N=6 | O=2 | smiles = O=C2N(c1nc(n(c1C(=O)N2C)C)NCCN(C(C)Cc3ccccc3)C)C }}
'''Fencamine''' ('''Altimina''', '''Sicoclor'''), also known as '''methamphetaminoethylcaffeine''', is a psychostimulant drug of the amphetamine class. It is closely related to fenethylline.<ref name="pmid12024689">{{cite journal | vauthors = Cody JT | title = Precursor medications as a source of methamphetamine and/or amphetamine positive drug testing results | journal = Journal of Occupational and Environmental Medicine | volume = 44 | issue = 5 | pages = 435–50 | date = May 2002 | pmid = 12024689 | doi = 10.1097/00043764-200205000-00012 | s2cid = 44614179 }}</ref> It is a prodrug of amphetamine and/or methamphetamine.<ref name="Musshoff2000">{{cite journal | vauthors = Musshoff F | title = Illegal or legitimate use? Precursor compounds to amphetamine and methamphetamine | journal = Drug Metab Rev | volume = 32 | issue = 1 | pages = 15–44 | date = February 2000 | pmid = 10711406 | doi = 10.1081/dmr-100100562 | url = }}</ref> The drug also contains a caffeine moiety in its chemical structure.
==See also== * Substituted amphetamine * Fenethylline
== References == {{Reflist}}
{{Stimulants}} {{Monoamine releasing agents}} {{Phenethylamines}}
Category:Designer prodrugs Category:Methamphetamines Category:Norepinephrine-dopamine releasing agents Category:Stimulants Category:Xanthines
{{nervous-system-drug-stub}}