{{Short description|Organic compound}} {{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443726976 | ImageFile = Enterodiol.png | ImageSize = 180px | PIN = (2''R'',3''R'')-2,3-Bis[(3-hydroxyphenyl)methyl]butane-1,4-diol | OtherNames = (−)-Enterodiol |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 80226-00-2 | PubChem = 115089 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = BZF4X2AWRP | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = C18166 | SMILES = C1=CC(=CC(=C1)O)C[C@@H](CO)[C@@H](CC2=CC(=CC=C2)O)CO | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 102992 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 471076 | InChI = 1/C18H22O4/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(22)10-14/h1-6,9-10,15-16,19-22H,7-8,11-12H2/t15-,16-/m0/s1 | InChIKey = DWONJCNDULPHLV-HOTGVXAUBO | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C18H22O4/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(22)10-14/h1-6,9-10,15-16,19-22H,7-8,11-12H2/t15-,16-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = DWONJCNDULPHLV-HOTGVXAUSA-N }} |Section2={{Chembox Properties | C=18|H=22|O=4 | Appearance = colorless | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Enterodiol''' is an organic compound with the formula [HOC<sub>6</sub>H<sub>4</sub>CH<sub>2</sub>CH(CH<sub>2</sub>OH)]<sub>2</sub>.
It is formed by the action of intestinal bacteria on lignan precursors. As such it is sometimes classified as a enterolignan or mammalian lignan.<ref>{{cite journal |doi=10.1080/10408360701612942|title=Lignans and Human Health|year=2007|last1=Adlercreutz|first1=Herman|journal=Critical Reviews in Clinical Laboratory Sciences|volume=44|issue=5–6|pages=483–525|pmid=17943494|s2cid=31753060}}</ref><ref>{{cite journal | author = Lampe JW | title = Isoflavonoid and lignan phytoestrogens as dietary biomarkers | journal = J Nutr | year = 2003 | volume = 133 | issue = Suppl 3 | pages = 956S–964S | pmid = 12612182 | doi=10.1093/jn/133.3.956S| doi-access = free }}</ref> Elevated levels of enterodiol in urine are attributed consumption of tea and other lignan-rich foods.<ref>{{cite journal |doi=10.1093/ajcn/54.6.1093|title=Urinary excretion of lignans and isoflavonoid phytoestrogens in Japanese men and women consuming a traditional Japanese Diet|year=1991|last1=Adlercreutz|first1=H.|last2= Honjo|first2=H.|last3=Higashi|first3=A.|last4=Fotsis|first4=T.|last5= Hämäläinen|first5=E.|last6=Hasegawa|first6=T.|last7=Okada|first7=H.|journal=The American Journal of Clinical Nutrition|volume=54|issue=6|pages=1093–1100|pmid=1659780|doi-access=free}}</ref>
==References== {{reflist}}
{{lignan}}
Category:Polyols Category:Lignans Category:3-Hydroxyphenyl compounds
{{aromatic-stub}}