{{Chembox | ImageFile = Drimane.png | ImageSize = 200px | ImageAlt = | IUPACName = Drimane | SystematicName = (4a''R'',5''S'',6''S'',8a''S'')-1,1,4a,5,6-Pentamethyldecahydronaphthalene | OtherNames = | Section1 = {{Chembox Identifiers | CASNo = 5951-58-6 | PubChem = 606283 | Beilstein = 2959385 | UNII = B6L7EVH458 | StdInChI=1S/C15H28/c1-11-7-8-13-14(3,4)9-6-10-15(13,5)12(11)2/h11-13H,6-10H2,1-5H3 | StdInChIKey = CVRSZZJUWRLRDE-UHFFFAOYSA-N | SMILES = C[C@H]1CC[C@@H]2[C@@]([C@H]1C)(CCCC2(C)C)C | ChemSpiderID = 7827642 }} | Section2 = {{Chembox Properties | C=15 | H=28 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Drimane''' is a bicyclic sesquiterpene. It is the parent structure of many natural products with various biological activity.<ref>{{cite journal |title= Occurrence, biological activity and synthesis of drimane sesquiterpenoids |first1= B. J. M. |last1= Jansena |first2= Ae. |last2= de Groota |journal= Nat. Prod. Rep. |year= 2004 |volume= 21 |issue= 4 |pages= 449–477 |doi= 10.1039/B311170A |pmid= 15282630 }}</ref>
Among the notable drimanes are: *Polygodial, found in several different plants *Multiple compounds found in several members of the family Canellaceae
== References == {{reflist}}
Category:Sesquiterpenes
{{organic-chem-stub}}