{{Chembox | Name = Disparlure | ImageFile = Disparlure.svg | ImageSize = 300px | ImageFile1 = | IUPACName = ''cis''-7,8-epoxy-2-methyloctadecane | OtherNames = (2''S''-''cis'')-2-Decyl-3-(5-methylhexyl)oxirane | Section1 = {{Chembox Identifiers | Beilstein = | CASNo = 54910-51-9 | CASNo_Ref = {{cascite|correct|CAS}} | EC_number = 259-390-8 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = A5ZD42XF7G | PubChem = 171384 | ChemSpiderID = 149826 | StdInChI=1S/C19H38O/c1-4-5-6-7-8-9-10-11-15-18-19(20-18)16-13-12-14-17(2)3/h17-19H,4-16H2,1-3H3/t18-,19+/m0/s1 | StdInChIKey = HFOFYNMWYRXIBP-RBUKOAKNSA-N | SMILES = CCCCCCCCCC[C@H]1[C@H](O1)CCCCC(C)C }} | Section2 = {{Chembox Properties | C=19 | H=38 | O=1 | Appearance = Viscous colorless oil | Density = 0.828 g cm<sup>−3</sup> at 25 °C | MeltingPt = | BoilingPtC = 146-148 }} | Section3 = {{Chembox Hazards | ExternalSDS = [http://www.sigmaaldrich.com/catalog/product/aldrich/510769?lang=en®ion=US External MSDS] | NFPA-H = 0 | NFPA-F = 2 | NFPA-R = 0 | FlashPtC = 52 }} }}
'''Disparlure''' (chemical name '''''cis''-7,8-epoxy-2-methyloctadecane''') is a chemical compound with the formula C<sub>19</sub>H<sub>38</sub>O. It is a sex pheromone found in moths, such as the spongy moth (''Lymantria dispar''), and is used to attract a mate.
==Occurrences== Disparlure is produced by female moths, such as the spongy and nun moths. It is a sex pheromone, a chemical that is released by the moths in order to attract a male mate.<ref name=Wang>{{cite journal | doi = 10.1002/cjoc.201100482 | title = Asymmetric Synthesis of Both Enantiomers of Disparlure | date = 2012 | last1 = Wang | first1 = Zhigang | last2 = Zheng | first2 = Jianfeng | last3 = Huang | first3 = Peiqiang | journal = Chinese Journal of Chemistry | volume = 30 | pages = 23–28 }}</ref> Disparlure has two enantiomers, referred to by (+) and (−). The (+)-enantiomer is typically used to attract the males by the females, while the (−)-enantiomer tends to have the opposite effect. The (−)-enantiomer inhibits attractions and turns the males away from females.<ref>{{cite journal | doi = 10.1111/j.1365-3032.1984.tb00676.x | title = Discrimination and production of disparlure enantiomers by the gypsy moth and the nun moth | date = 1984 | last1 = Hansen | first1 = Kurt | journal = Physiological Entomology | volume = 9 | pages = 9–18 }}</ref>
==Uses== Disparlure, which is the synthetic form of the spongy moth sex pheromone, is used to detect its newly founded populations and estimate population density across the United States.<ref>{{cite journal | doi = 10.1603/EC11063 | title = Field Evaluation of Effect of Temperature on Release of Disparlure from a Pheromone-Baited Trapping System Used to Monitor Gypsy Moth (Lepidoptera: Lymantriidae) | date = 2011 | last1 = Tobin | first1 = Patrick C. | last2 = Zhang | first2 = Aijun | last3 = Onufrieva | first3 = Ksenia | last4 = Leonard | first4 = Donna S. | journal = Journal of Economic Entomology | volume = 104 | issue = 4 | pages = 1265–1271 | pmid = 21882691 }}</ref> The spongy moth is a very harmful pest for plants and affects forest, shade, and orchard trees across North America and parts of Europe. Using disparlure as a pest management tool has been shown to be effective to reduce damage to forests.<ref name=Koumbis>{{cite journal | doi = 10.1016/j.tetlet.2005.04.081 | title = A short and efficient synthesis of (+)-disparlure and its enantiomer | date = 2005 | last1 = Koumbis | first1 = Alexandros E. | last2 = Chronopoulos | first2 = Demetrios D. | journal = Tetrahedron Letters | volume = 46 | issue = 25 | pages = 4353–4355 }}</ref> This pheromone can usually be applied to trap, catch and disrupt spongy moth mating in order to address the economic and environmental impacts caused by the expanding range of infestation. Successful mating attempts can be significantly reduced as a result.<ref>{{cite journal | doi =10.1111/j.1570-7458.2007.00613.x | title =Persistent effects of aerial applications of disparlure on gypsy moth: Trap catch and mating success | date =2007 | last1 =Thorpe | first1 =Kevin W. | last2 =Tcheslavskaia | first2 =Ksenia S. | last3 =Tobin | first3 =Patrick C. | last4 =Blackburn | first4 =Laura M. | last5 =Leonard | first5 =Donna S. | last6 =Roberts | first6 =E. Anderson | journal =Entomologia Experimentalis et Applicata | volume =125 | issue =3 | pages =223–229 | bibcode =2007EEApp.125..223T }}</ref>
==Synthesis==
There are two main ways to synthesize disparlure. They are either using chiral pools, which are costly and time consuming, or asymmetric epoxidation, which is quick, easy, and cheap. Some studies have used asymmetric epoxidation, which involves processes such as constructing an epoxide ring from the diols, filtrations, and chromatography. This procedure can produce yields over 70% using a six-step process that is simple and inexpensive.<ref name=Koumbis/> This strategy, as well as others, can be used to investigate other insect sex pheromones because these methods are so flexible and reliable. The synthesis of disparlure found that the natural form (+) is more active than its (-)-enantiomer and there have been over twenty different approaches to synthesize the natural form of disparlure.<ref name=Wang/> One such method involved four steps beginning with the formation of a ''cis''-vinyl epoxide by reacting undecanyl aldehydes with (''Z'')-(γ-chloroallyl)diisopinocampheylborane. Hydroboration and oxidation of this cis-vinyl epoxide yields a cis-3,4-epoxy alcohol that can then be purified using recrystallization. The final step is tosylation and alkylation of the alcohol which gives (+)-''cis''-7,8-epoxy-2-methyloctadecane with high yield.<ref>{{cite journal | doi = 10.1021/jo9820871 | title = An Efficient Enantioselective Synthesis of (+)-Disparlure | date = 1999 | last1 = Hu | first1 = Shaojing | last2 = Jayaraman | first2 = Seetharaman | last3 = Oehlschlager | first3 = Allan C. | journal = The Journal of Organic Chemistry | volume = 64 | issue = 10 | pages = 3719–3721 }}</ref> Additionally, the stereospecific Gringard products of (''R'')-2,3-cyclohexylideneglyceraldehyde are two 1,2-''syn''-diols that can be used to produce either enantiomer of disparlure. Additionally, a simple reaction of disparlure with an aqueous solution of weak acid and potassium permanganate produces undecanoic acid and 6-methyl-heptanoic acid, two carboxylic acids.<ref>{{cite book | author = McMurray, J. |date = 2011 | title = Organic Chemistry: With Biological Applications | edition = Second | publisher = Belmont. Mary Finch }}</ref><ref>{{cite journal | doi = 10.1016/j.tetasy.2011.08.013 | title = An enantiodivergent synthesis of both (+)- and (−)-disparlure from (R)-2,3-cyclohexylideneglyceraldehyde | date = 2011 | last1 = Dubey | first1 = Akhil Kumar | last2 = Chattopadhyay | first2 = Angshuman | journal = Tetrahedron: Asymmetry | volume = 22 | issue = 14–15 | pages = 1516–1521 }}</ref>
:thumb|400px|left|Another route to synthesize disparlure{{clear-left}}
Reagents and conditions: * (i) Ph<sub>3</sub>P<sup>+</sup>(CH<sub>2</sub>)<sub>8</sub>CH<sub>3</sub>Br<sup>−</sup>, ''n''-BuLi, THF, 0 °C to room temperature, 97% * (ii) (COCl)<sub>2</sub>, DMSO, CH<sub>2</sub>Cl<sub>2</sub> then Et<sub>3</sub>N, −55 °C to room temperature; * (iii) Ph<sub>3</sub>P+(CH<sub>2</sub>)<sub>3</sub>CH(CH<sub>3</sub>)<sub>2</sub>Br<sup>−</sup>, n-BuLi, THF, 0 °C to room temperature, 90% overall from 14; * (iv) H<sub>2</sub>, Ra-Ni, MeOH, room temperature, 96%; * (v) 37% HCl, THF/H<sub>2</sub>O (2:1), room temperature, 99%; * (vi) (a) CH<sub>3</sub>C(OEt)<sub>3</sub>, PPTS, toluene, 110 °C; (b) TMSCl, CH<sub>2</sub>Cl<sub>2</sub>, room temperature; (c) 1 N KOH in MeOH, THF, 0 °C to room temperature, 88%.<ref name=Koumbis/>
==References== {{Reflist}}
Category:Epoxides Category:Pheromones