{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 401008559 | Name = Diosmetin | ImageFile = Diosmetin.svg | ImageClass = skin-invert-image | ImageSize = 220px | ImageName = Diosmetin structure | ImageFile1 = Diosmetin molecule ball.png | ImageClass1 = bg-transparent | ImageSize1 = 220 | ImageAlt1 = Ball-and-stick model of diosmetin | IUPACName = 3′,5,7-Trihydroxy-4′-methoxyflavone | SystematicName = 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4''H''-benzopyran-4-one | OtherNames = Luteolin 4′-methyl ether |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 520-34-3 | UNII_Ref = {{fdacite|changed|FDA}} | UNII = TWZ37241OT | SMILES = COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 4444931 | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C16H12O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-7,17-19H,1H3 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = MBNGWHIJMBWFHU-UHFFFAOYSA-N | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 90568 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 4630 | PubChem = 5281612 }} |Section2={{Chembox Properties | Formula = C<sub>16</sub>H<sub>12</sub>O<sub>6</sub> | MolarMass = 300.26 g/mol | Density = | MeltingPt = | BoilingPt = }} }}

'''Diosmetin''', also known as '''5,7,3′-trihydroxy-4′-methoxyflavone''', is an ''O''-methylated flavone, a chemical compound that can be found in the Caucasian vetch.<ref>{{cite journal | url=https://doi.org/10.1007%2FBF02465832 | doi=10.1007/BF02465832 | title=Diosmetin glycosides from caucasian vetch: Isolation and study of biological activity | year=1998 | last1=Andreeva | first1=O. A. | last2=Ivashev | first2=M. N. | last3=Ozimina | first3=I. I. | last4=Maslikova | first4=G. V. | journal=Pharmaceutical Chemistry Journal | volume=32 | issue=11 | pages=595–597 | s2cid=21434373 | url-access=subscription }}</ref>

It has been found to act as a weak TrkB receptor agonist.<ref name="pmid20133810">{{cite journal | vauthors = Jang SW, Liu X, Yepes M, Shepherd KR, Miller GW, Liu Y, Wilson WD, Xiao G, Blanchi B, Sun YE, Ye K | title = A selective TrkB agonist with potent neurotrophic activities by 7,8-dihydroxyflavone | journal = Proc. Natl. Acad. Sci. U.S.A. | volume = 107 | issue = 6 | pages = 2687–92 | year = 2010 | pmid = 20133810 | pmc = 2823863 | doi = 10.1073/pnas.0913572107 | bibcode = 2010PNAS..107.2687J | doi-access = free }}</ref>

==Glycosides== Diosmetin is the aglycone of diosmin.

==See also== * Tropomyosin receptor kinase B § Agonists

==References== {{Reflist}}

{{Flavones}} {{Growth factor receptor modulators}}

Category:O-methylated flavones Category:Resorcinols Category:TrkB agonists Category:3-Hydroxypropenals within hydroxyquinones Category:Triols

{{Aromatic-stub}}