{{chembox | Verifiedfields = changed | verifiedrevid = 470638079 | ImageFile=Zoalene.png | ImageSize=150px | PIN = 2-Methyl-3,5-dinitrobenzamide | OtherNames = 3,5-Dinitro-''o''-toluamide<br />Zoalene |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 2982 | InChI = 1/C8H7N3O5/c1-4-6(8(9)12)2-5(10(13)14)3-7(4)11(15)16/h2-3H,1H3,(H2,9,12) | InChIKey = ZEFNOZRLAWVAQF-UHFFFAOYAL | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 472565 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C8H7N3O5/c1-4-6(8(9)12)2-5(10(13)14)3-7(4)11(15)16/h2-3H,1H3,(H2,9,12) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = ZEFNOZRLAWVAQF-UHFFFAOYSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo=148-01-6 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = AOX68RY4TV | PubChem=3092 | SMILES = O=[N+]([O-])c1cc(cc(C(=O)N)c1C)[N+]([O-])=O }} |Section2={{Chembox Properties | Formula=C<sub>8</sub>H<sub>7</sub>N<sub>3</sub>O<sub>5</sub> | MolarMass=225.16 g/mol | Appearance= | Density= | MeltingPtF=351 | MeltingPt_ref =<ref name=PGCH/> | BoilingPt= | Solubility= }} |Section6={{Chembox Pharmacology | ATCvet = yes | ATCCode_prefix = P51 | ATCCode_suffix = AX12 }} |Section7={{Chembox Hazards | MainHazards= | FlashPt=noncombustible | FlashPt_ref = <ref name=PGCH/> | AutoignitionPt = | PEL = none<ref name=PGCH>{{PGCH|0230}}</ref> | REL = TWA 5 mg/m<sup>3</sup><ref name=PGCH/> | IDLH = N.D.<ref name=PGCH/> }} }}

'''Dinitolmide''' (or '''zoalene''') is a fodder additive for poultry, used to prevent coccidiosis infections.<ref name="Gerhold">{{Cite journal | doi = 10.1637/9572-101310-Reg.1 | last1 = Gerhold | first1 = R. W. | last2 = Fuller | first2 = A. L. | last3 = Lollis | first3 = L. | last4 = Parr | first4 = C. | last5 = McDougald | first5 = L. R. | title = The Efficacy of Anticoccidial Products against ''Eimeria'' spp. in Northern Bobwhites | journal = Avian Diseases | volume = 55 | issue = 1 | pages = 59–64 | year = 2011 | pmid = 21500637 | s2cid = 30943649 }}</ref> It is sold under trade names such as '''Coccidine A''', '''Coccidot''', and '''Zoamix'''.

Dinitolmide is usually added to feed in doses of 125&nbsp;ppm (preventive) or 250&nbsp;ppm (curative). It is a broad-spectrum anticoccidial drug,<ref name="Gerhold" /> preventing seven main strains of ''Eimeria coccidium''. It leaves no residues in tissues.{{fact|date=December 2013}} It can be also used to prevent coccidiosis of domestic rabbits.

==References== {{reflist}}

==External links== * [https://dailymed.nlm.nih.gov/dailymed/archives/fdaDrugInfo.cfm?archiveid=15274 Zoamix - DailyMed]

Category:Nitrotoluene derivatives Category:Poultry farming Category:Benzamides

{{antiinfective-drug-stub}}