{{Short description|Stimulant and empathogenic drug}} {{Drugbox | drug_name = Dimethylone | IUPAC_name = 1-(1,3-benzodioxol-5-yl)-2-(dimethylamino)propan-1-one | image = Dimethylone.svg | image_class = skin-invert-image
| width= 250px
<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_BR = F2 | legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}</ref> | legal_CA = Schedule I | legal_DE = NpSG | legal_UK = PSA | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 765231-58-1 | CAS_supplemental = <BR> 109367-07-9 (HCl) | ATC_prefix = None | ATC_suffix = | PubChem = 9794472 | ChemSpiderID = 7970239 | UNII = 4G26NSP297
<!--Chemical data--> | C=12 | H=15 | N=1 | O=3 | smiles = CC(C(=O)C1=CC2=C(C=C1)OCO2)N(C)C | StdInChI = 1S/C12H15NO3/c1-8(13(2)3)12(14)9-4-5-10-11(6-9)16-7-15-10/h4-6,8H,7H2,1-3H3 | StdInChIKey = OSNIIMCBVLBNGS-UHFFFAOYSA-N | melting_point = | melting_high = }}
'''Dimethylone''' ('''βk-MDDMA''') is a substituted cathinone derivative with stimulant and empathogenic effects. Unlike the corresponding amphetamine derivative MDDM which is thought to be practically inactive, dimethylone substitutes for methamphetamine and MDMA in animal studies and has been sold as a designer drug.<ref>{{cite journal | vauthors = Zaitsu K, Katagi M, Kamata HT, Miki A, Tsuchihashi H | title = Discrimination and identification of regioisomeric β-keto analogues of 3,4-methylenedioxyamphetamines by gas chromatography-mass spectrometry. | journal = Forensic Toxicol | date = 2008 | volume = 26 | issue = 2 | pages = 45–51 | doi = 10.1007/s11419-008-0050-1| s2cid = 2871089 }}</ref><ref>{{cite journal | vauthors = Kikura-Hanajiri R, Uchiyama N, Goda Y | title = Survey of current trends in the abuse of psychotropic substances and plants in Japan | journal = Legal Medicine | volume = 13 | issue = 3 | pages = 109–15 | date = May 2011 | pmid = 21377397 | doi = 10.1016/j.legalmed.2011.02.003 }}</ref><ref>{{cite journal | vauthors = Krotulski AJ, Mohr AL, Fogarty MF, Logan BK | title = The Detection of Novel Stimulants in Oral Fluid from Users Reporting Ecstasy, Molly and MDMA Ingestion | journal = Journal of Analytical Toxicology | volume = 42 | issue = 8 | pages = 544–553 | date = October 2018 | pmid = 30371847 | doi = 10.1093/jat/bky051 | doi-access = free }}</ref><ref name="pmid30986635">{{cite journal | vauthors = Gatch MB, Dolan SB, Forster MJ | title = Locomotor activity and discriminative stimulus effects of five novel synthetic cathinone analogs in mice and rats | journal = Drug and Alcohol Dependence | volume = 199 | pages = 50–58 | date = June 2019 | pmid = 30986635 | pmc = 6534427 | doi = 10.1016/j.drugalcdep.2019.02.016 }}</ref>
== Legal status == In the United States, dimethylone is considered a Schedule I controlled substance as a positional isomer of butylone.<ref>{{Cite report |url=https://www.deadiversion.usdoj.gov/schedules/orangebook/orangebook.pdf |title=Lists of: Scheduling Actions, Controlled Substances, Regulated Chemicals |date=November 2025 |access-date=November 21, 2025}}</ref>
== See also == * Substituted methylenedioxyphenethylamine * Dimethylcathinone * Dibutylone * Dipentylone * Methylone * Ethylone * Butylone * Eutylone * Ephylone * 5-Methylethylone * MDPPP
== References == {{Reflist}}
{{Entactogens}} {{Phenethylamines}}
Category:Designer drugs Category:Dimethylamino compounds Category:Methylenedioxycathinones Category:Serotonin-norepinephrine-dopamine releasing agents
{{psychoactive-stub}}