{{Chembox | Watchedfields = changed | verifiedrevid = 443691896 | ImageFile = DimethylChlorendate.svg | PIN = Dimethyl (1''R'',2''R'',3''S'',4''S'')-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate | OtherNames = Dimethyl hexachloroendomethylenetetrahydrophthalate; 1,4,5,6,7,7-Hexachlorobicyclo(2.2.1)hept-5-ene-2,3-dicarboxylic acid dimethyl ester; NSC12446 |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 1773-89-3 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2T60Q2D44E | PubChem = 164881 | EINECS = 217-202-1 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 24751856 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C11H8Cl6O4/c1-20-7(18)3-4(8(19)21-2)10(15)6(13)5(12)9(3,14)11(10,16)17/h3-4H,1-2H3/t3-,4+,9-,10+ | SMILES = COC(=O)[C@H]1[C@H]([C@@]2(C(=C([C@]1(C2(Cl)Cl)Cl)Cl)Cl)Cl)C(=O)OC | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = MDHHRPHYYRMIPH-OWEGFZGBSA-N }} |Section2={{Chembox Properties | C=11 | H=8 | Cl=6 | O=4 | Appearance = | Density = 1.71 g/cm<sup>3</sup> | MeltingPt = | BoilingPtC = 428.4 | BoilingPt_notes = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPtC = 162.8 | AutoignitionPtC = }} | Reference = <ref name="PubChem">{{cite web | url = https://pubchem.ncbi.nlm.nih.gov/compound/164881 | title = Dimethyl chlorendate - PubChem Public Chemical Database | publisher = PubChem | access-date = 2010-12-17 }}</ref><ref name="ChemIndustry.com">{{cite web | url = http://www.chemindustry.com/chemicals/01727938.html | title = NSC 12446, CAS Number: 1773-89-3 | publisher = ChemIndustry.com | access-date = 2010-12-17 }}</ref><ref name="Museum of Learning">{{cite web | url = http://www.museumstuff.com/learn/topics/dimethyl_chlorendate | title = Dimethyl chlorendate : Define, Explore, Discuss | publisher = Museum of Learning | access-date = 2010-12-17 }}</ref><ref name="Chemical Register">{{cite web | url = http://www.chemicalregister.com/DIMETHYL_CHLORENDATE/Suppliers/pid268825.htm | title = DIMETHYL CHLORENDATE CAS 1773-89-3 | publisher = Chemical Register | access-date = 2010-12-17 }}</ref> }}
'''Dimethyl chlorendate''' is a chlorendic acid used as a flame retardant additive.
==References== {{Reflist}}
Category:Organochlorides Category:Flame retardants Category:IARC Group 2B carcinogens Category:Methyl esters
{{organohalide-stub}}