{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 451228130 | IUPAC_name = (''RS'' or ''S'')-1-[3-aminopropyl]-1-<br/>(4-fluorophenyl)-1,3-dihydroisobenzofuran-5-carbonitrile | image = Didesmethylescitalopram skeletal.svg | image_class = skin-invert-image | width = <!-- Clinical data --> | tradename = | pregnancy_category = | legal_status = uncontrolled | routes_of_administration = <!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = 100 h | excretion = <!-- Identifiers --> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 62498-69-5 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = ZE9YVI4ZEE | ATC_prefix = none | ATC_suffix = | PubChem = | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 23935928 | smiles = c1cc(ccc1[C@]2(c3ccc(cc3CO2)C#N)CCCN)F | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C18H17FN2O/c19-16-5-3-15(4-6-16)18(8-1-9-20)17-7-2-13(11-21)10-14(17)12-22-18/h2-7,10H,1,8-9,12,20H2/t18-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = RKUKMUWCRLRPEJ-SFHVURJKSA-N <!-- Chemical data --> | C=18 | H= 17 | F= 1 | N= 2 | O= 1 }} '''Didesmethylcitalopram''' is an active metabolite of the antidepressant drug citalopram (racemic).<ref name="pmid2365786">{{cite journal | vauthors = Rop PP, Durand A, Viala A, Jørgensen A | title = Simultaneous determination of citalopram, monodesmethylcitalopram and didesmethylcitalopram in plasma by high-performance liquid chromatography after column extraction | journal = Journal of Chromatography | volume = 527 | issue = 1 | pages = 226–32 | date = April 1990 | pmid = 2365786 | doi = 10.1016/s0378-4347(00)82105-2 }}</ref> '''Didesmethyl''es''citalopram''' is an active metabolite of the antidepressant escitalopram, the ''S''-enantiomer of citalopram. Like citalopram and escitalopram, didesmethyl(es)citalopram functions as a selective serotonin reuptake inhibitor (SSRI), and is responsible for some of its parents' therapeutic benefits.

== See also == {{div col|colwidth=30em}} * Desmethylcitalopram * Desmethylsertraline * Desmethylvenlafaxine * Norfluoxetine {{div col end}}

== References == {{Reflist}}

{{Antidepressants}} {{Serotonergics}}

Category:Isobenzofurans Category:Nitriles Category:4-Fluorophenyl compounds Category:Human drug metabolites

{{nervous-system-drug-stub}}