{{Redirect|DCIP|the children's rights organization|Defence for Children Palestine}} {{More citations needed|date=June 2015}} {{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443636065 | ImageFile1 = DCPIP-2D-skeletal.png | ImageSize1 = 150px | ImageFileL2 = Dichlorphenolindophenol-3D-balls.png | ImageFileR2 = Dichlorphenolindophenol-3D-vdW.png | PIN = 4-(3,5-dichloro-4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one | OtherNames = Dichloroindophenol ();<br /> 2,6-Dichlorophenolindophenol;<br /> 2,6-Dichloroindophenol;<br /> 2,6-Dichloro-4-[(4-hydroxyphenyl)imino]-2,5-cyclohexadien-1-one |Section1={{Chembox Identifiers | Abbreviations = DCPIP, DCIP, DPIP | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = C00102 | InChI = 1/C12H7Cl2NO2/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7/h1-6,16H | InChIKey = CCBICDLNWJRFPO-UHFFFAOYAL | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 500871 | PubChem = 13726 | ChemSpiderID = 10661857 | UNII = C35QN2Z58B | EC_number = 213-479-8 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C12H7Cl2NO2/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7/h1-6,16H | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = CCBICDLNWJRFPO-UHFFFAOYSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 956-48-9 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 945 | SMILES = Cl\C2=CC(=N/c1ccc(O)cc1)/C=C(/Cl)C2=O }} |Section2={{Chembox Properties | C = 12 | H = 7 | N = 1 | Cl = 2 | O = 2 }} |Section7 = {{Chembox Hazards | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|302|315|319|335}} | PPhrases = {{P-phrases|261|264|270|271|280|301+312|302+352|304+340|305+351+338|312|321|330|332+313|337+313|362|403+233|405|501}} }} }}

'''2,6-Dichlorophenolindophenol''' ('''DCPIP''', '''DCIP''' or '''DPIP''') is a chemical compound used as a redox dye. When oxidized, DCPIP is blue with a maximal absorption at 600&nbsp;nm; when reduced, DCPIP is colorless.

DCPIP can be used to measure the rate of photosynthesis and is an example of a Hill reagent. When exposed to light in a photosynthetic system, the dye is decolorised by chemical reduction. DCPIP has a higher affinity for electrons than ferredoxin and the photosynthetic electron transport chain can reduce DCPIP as a substitute for NADP<sup>+</sup>, that is normally the final electron carrier in photosynthesis. As DCPIP is reduced and becomes colorless, the resultant increase in light transmittance can be measured using a spectrophotometer.

471x471px|The reduction of DCPIP

DCPIP can also be used as an indicator for vitamin C.<ref>{{cite journal |vauthors=VanderJagt DJ, Garry PJ, Hunt WC |title=Ascorbate in plasma as measured by liquid chromatography and by dichlorophenolindophenol colorimetry |journal=Clin. Chem. |volume=32 |issue=6 |pages=1004–6 |date=June 1986 |pmid=3708799 |url=http://www.clinchem.org/cgi/pmidlookup?view=long&pmid=3708799}}</ref><ref>{{Citation |title=Design an investigation to compare the amount of vitamin C in different fruits and vegetables |url=https://www.youtube.com/watch?v=fxl4Ar2cD0A |access-date=2023-11-18 |language=en}}</ref> If vitamin C, which is a good reducing agent, is present, the blue dye, which turns pink in acidic conditions, is reduced to a colorless compound by ascorbic acid. This reaction is a redox reaction: vitamin C (ascorbic acid) is oxidized to dehydroascorbic acid, and DCPIP is reduced to the colorless compound DCPIPH<sub>2</sub>

:DCPIP (blue) + H<sup>+</sup> → DCPIPH (pink) :DCPIPH (pink) + vitamin C → DCPIPH<sub>2</sub> (colorless)

In this titration, when all the ascorbic acid in the solution has been used up, there will not be any electrons available to reduce the DCPIPH and the solution remains pink due to the DCPIPH. The end point is a pink color that persists for 10 seconds or more, if there is not enough ascorbic acid to reduce all of the DCPIPH. Pharmacological experiments suggest that DCPIP may serve as a pro-oxidant chemotherapeutic targeting human cancer cells in an animal model of human melanoma; DCPIP-induced cancer cell death occurs by depletion of intracellular glutathione and upregulation of oxidative stress.<ref>{{cite journal |vauthors=Cabello CM, Bair WB, Bause AS, Wondrak GT |title=Antimelanoma activity of the redox dye DCPIP (2,6-dichlorophenolindophenol) is antagonized by NQO1 |journal=Biochem. Pharmacol. |volume=78 |issue=4 |pages=344–54 |date=August 2009 |pmid=19394313 |doi=10.1016/j.bcp.2009.04.016 |pmc=2742658}}</ref>

==See also== *Indophenol *Metachromasy *Methylene blue *Wurster's blue

==References== {{reflist}}

Category:Biochemistry detection reactions Category:Indophenol dyes Category:Redox indicators Category:Chloroarenes Category:4-Hydroxyphenyl compounds