{{short description|Chemical compound}} {{Drugbox | Verifiedfields = | Watchedfields = | verifiedrevid = | IUPAC_name = 4-[(1''E'')-3-(4-Hydroxyphenyl)-2-methylpent-1-en-1-yl]phenol | image = Dianol.svg | image_class = skin-invert-image | width = 200px <!--Clinical data--> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = <!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = <!-- Identifiers --> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 1365640-31-8 | CAS_supplemental = | ATCvet = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 129557827 | UNII = | KEGG = | ChEBI = | ChEMBL = <!--Chemical data--> | C= 18| H= 20 | O= 2 | molecular_weight = | smiles = CCC(\C(C)=C\C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 | StdInChI_Ref = | StdInChI = 1/C18H20O2/c1-3-18(15-6-10-17(20)11-7-15)13(2)12-14-4-8-16(19)9-5-14/h4-12,18-20H,3H2,1-2H3/b13-12+ | StdInChIKey_Ref = | StdInChIKey = LYDGPZXLJYBDEM-OUKQBFOZNA-N }}

'''Dianol''' is a synthetic, nonsteroidal estrogen that was never marketed.<ref name="Dodds2008">{{cite journal| vauthors = Dodds EC |title=Synthetic œstrogens in treatment|journal=The Irish Journal of Medical Science|volume=25|issue=7|year=2008|pages=305–314|issn=0021-1265|doi=10.1007/BF02950685|s2cid=58062466}}</ref> It is a dimer and impurity of anol, and was, along with hexestrol, involved in erroneous findings of highly potent estrogenic activity with anol.<ref name="MaximovMcDaniel2013">{{cite book| vauthors = Maximov PY, McDaniel RE, Jordan VC | chapter = Discovery and Pharmacology of Nonsteroidal Estrogens and Antiestrogens |title=Tamoxifen: Pioneering Medicine in Breast Cancer| series = Milestones in Drug Therapy | chapter-url=https://books.google.com/books?id=p-W5BAAAQBAJ&pg=PA3|date=23 July 2013|publisher=Springer Science & Business Media|isbn=978-3-0348-0664-0 | doi = 10.1007/978-3-0348-0664-0_1 |pages=3–}}</ref><ref name="AcademicPress1945">{{cite book | vauthors = Dodds EC | chapter = Possibilities in the Realm of Synthetic Estrogens| veditors = Harris RS, Thimann KV |title=Vitamins and Hormones|url=https://archive.org/details/in.ernet.dli.2015.5563|date=1 January 1945 | volume = 3| publisher=Academic Press |isbn=978-0-08-086600-0 |pages=[https://archive.org/details/in.ernet.dli.2015.5563/page/n252 232]– | doi = 10.1016/S0083-6729(08)61113-9}}</ref><ref name="Ravina2011">{{cite book| vauthors = Ravina E | chapter = Nature as a Source of Drugs: Drugs from Natural Products |title=The Evolution of Drug Discovery: From Traditional Medicines to Modern Drugs| chapter-url = https://books.google.com/books?id=iDNy0XxGqT8C&pg=PA177 |date=11 January 2011|publisher=John Wiley & Sons|isbn=978-3-527-32669-3|pages=177–}}</ref> Although a potent estrogen, it requires a dose of 100&nbsp;μg to show activity, whereas hexestrol shows activity with a mere dose of 0.2&nbsp;μg.<ref name="pmid21013428">{{cite journal | vauthors = Solmssen UV | title = Synthetic estrogens and the relation between their structure and their activity | journal = Chemical Reviews | volume = 37 | issue = 3 | pages = 481–598 | date = December 1945 | pmid = 21013428 | doi = 10.1021/cr60118a004 }}</ref>

== See also == * Anethole * Dianethole * Diethylstilbestrol * Stilbestrol

== References == {{Reflist}}

{{Estrogen receptor modulators}}

Category:4-Hydroxyphenyl compounds Category:Synthetic estrogens

{{genito-urinary-drug-stub}}