{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = 4-[(1''S'')-2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-hydroxyethyl]phenol | image = Denopamine.svg | image_class = skin-invert-image | width = 275

<!--Clinical data-->| tradename = | Drugs.com = {{drugs.com|international|denopamine}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = Rx-only <small>(JP)</small> | routes_of_administration = By mouth

<!--Pharmacokinetic data-->| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = <!--Identifiers--> | CAS_number = 71771-90-9 | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem = 71754 | ChEMBL = 493682 | IUPHAR_ligand = 534 | DrugBank = | ChemSpiderID = 64795 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = V5F60UPD8P | KEGG = D02614

<!--Chemical data-->| chemical_formula = | C = 18 | H = 23 | N = 1 | O = 4 | smiles = O(c1ccc(cc1OC)CCNC[C@@H](O)c2ccc(O)cc2)C }}

'''Denopamine''' (INN) is a drug which acts as a β<sub>1</sub> adrenergic receptor agonist.<ref>{{cite journal | vauthors = Ishide T | title = Denopamine, a selective beta1-receptor agonist and a new coronary vasodilator | journal = Current Medical Research and Opinion | volume = 18 | issue = 7 | pages = 407–13 | year = 2002 | pmid = 12487507 | doi = 10.1185/030079902125001119 | s2cid = 25048757 }}</ref> It is used in the treatment of angina<ref>{{cite journal | vauthors = Nakajima D, Negoro N, Nakaboh A, Nakakoji T, Hoshiga M, Nariyama J, Ishihara T, Hanafusa T | display-authors = 6 | title = Effectiveness of low dose denopamine, a beta1-adrenoceptor agonist, in a patient with vasospastic angina refractory to intensive medical treatment | journal = International Journal of Cardiology | volume = 108 | issue = 2 | pages = 281–3 | date = April 2006 | pmid = 15913812 | doi = 10.1016/j.ijcard.2005.03.012 }}</ref> and may also have potential uses in the treatment of congestive heart failure<ref>{{cite journal | vauthors = Nishio R, Matsumori A, Shioi T, Wang W, Yamada T, Ono K, Sasayama S | title = Denopamine, a beta1-adrenergic agonist, prolongs survival in a murine model of congestive heart failure induced by viral myocarditis: suppression of tumor necrosis factor-alpha production in the heart | journal = Journal of the American College of Cardiology | volume = 32 | issue = 3 | pages = 808–15 | date = September 1998 | pmid = 9741531 | doi = 10.1016/S0735-1097(98)00314-3 | hdl = 2433/181223 | hdl-access = free }}</ref> and for clearing pulmonary edema.<ref>{{cite journal | vauthors = Sakuma T, Hida M, Nambu Y, Osanai K, Toga H, Takahashi K, Ohya N, Inoue M, Watanabe Y | display-authors = 6 | title = Beta1-adrenergic agonist is a potent stimulator of alveolar fluid clearance in hyperoxic rat lungs | journal = Japanese Journal of Pharmacology | volume = 85 | issue = 2 | pages = 161–6 | date = February 2001 | pmid = 11286398 | doi = 10.1254/jjp.85.161 | doi-access = free }}</ref> It is marketed in Japan under the brand name '''Kalgut''' and available as tablets of 5 and 10&nbsp;mg, and 5% fine granules.<ref>{{cite web|title=Kalgut (denopamine) Tablets 5, 10 mg; Fine granules 5%. Full Prescribing Information|url=https://medical.mt-pharma.co.jp/di/file/dc/kal.pdf|publisher=Mitsubishi Tanabe Pharma Corporation|access-date=6 March 2016|language=Japanese}}</ref>

== References == {{reflist|2}}

{{Cardiac stimulants excluding cardiac glycosides}} {{Adrenergic receptor modulators}}

Category:Beta1-adrenergic agonists Category:Phenylethanolamines Category:Catechol ethers Category:4-Hydroxyphenyl compounds

{{cardiovascular-drug-stub}}