{{Use dmy dates|date=April 2026}} {{Chembox | Name = | OtherNames = {{ubl|CP 52 223 (development code)|2-Chloro-''N''-(2,6-dimethylphenyl)-''N''-[(2-methylpropoxy)methyl]acetamide|делахлор (Russian)|délachlore (French)|异丁草胺 (Chinese)}} | IUPACName = 2-Chloro-2′,6′-dimethyl-''N''-[(2-methylpropoxy)methyl]acetanilide | PIN = 2-Chloro-''N''-(2,6-dimethylphenyl)-''N''-[(2-methylpropoxy)methyl]acetamide | SystematicName = | ImageFile = Delachlor.svg | ImageSize = 200px |Section1={{Chembox Identifiers | CASNo_Ref = <ref name = "tpe"/> | CASNo =24353-58-0 | ChEBI = 82177 | ChemSpiderID = 29961 | DTXSID = DTXSID2041836 | KEGG =C19050 | PubChem = 32321 | UNII = XQZ88T1A4A | InChI =InChI=1S/C15H22ClNO2/c1-11(2)9-19-10-17(14(18)8-16)15-12(3)6-5-7-13(15)4/h5-7,11H,8-10H2,1-4H3 | InChIKey = BIQOEDQVNIYWPQ-UHFFFAOYSA-N | StdInChI_Ref = <ref>{{cite web |title=delachlor data sheet |url=http://www.bcpcpesticidecompendium.org/delachlor.html |website=www.bcpcpesticidecompendium.org |access-date=22 February 2026}}</ref> | SMILES = CC1=C(C(=CC=C1)C)N(COCC(C)C)C(=O)CCl }} | Section2 = {{Chembox Properties | C=15|H=22|Cl=1|N=1|O=2 | Appearance = colourless or very pale yellow<ref name = "dutch sds"/> | Odor = | Density = 1.101<ref>{{cite web |title=Delachlor |website=echemi.com |url=https://www.echemi.com/products/pd180824129188-delachlor.html }}</ref> | MeltingPtC = | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = 59 ppm<ref name = "tpe"/> | Solvent1 = acetone | Solubility1 = | Solvent2 = dimethylformide | Solubility2 = | Solvent3 = ethanol | Solubility3 = | Solvent4 = cyclohexane | Solubility4 = | Solvent5 = tetrahydrofuran | Solubility5 = | Solvent6 = benzene | Solubility6 = | VaporPressure = }} | Section3 = {{Chembox Hazards | GHS_ref = <ref name="dutch sds">{{cite web |title=VEILIGHEIDSINFORMATIEBLAD |url=https://www.lgcstandards.com/medias/sys_master/root/ha8/h43/11029122056222/SDS_DRE-C12117000_ST-WB-MSDS-6483451-1-1-1/SDS-DRE-C12117000-ST-WB-MSDS-6483451-1-1-1.PDF |publisher=LGC Standards |date=12 Feb 2024 |trans-title=Safety Data Sheet}}</ref> | MainHazards = | GHSPictograms = | GHSSignalWord = Warning | PPhrases = {{PPhrases|260|264|273|280|391|501}} | HPhrases = {{HPhrases|302|312|315|317|319|332|351|361f|373|410}} | LD50 = {{ubl|1775 mg/kg (mouse, oral)|2000 mg/kg (rat, dermal)<ref name = "dutch sds"/>}} | LC50 = | FlashPt = | AutoignitionPt = }} |Section4={{Chembox Related | OtherCompounds = }} }} '''Delachlor''' is a chloroacetanilide herbicide, used on grasses, rice and sugarbeet.<ref name = "tpe">{{cite book |last1=Paranjape |first1=Kalyani |last2=Gowariker |first2=Vasant |last3=Krishnamurthy |first3=V.N. |last4=Gowariker |first4=Sudha |publisher=CABI |date = 2015 |title=The Pesticide Encyclopedia |isbn=978-1-78064-014-3}}</ref><ref>{{cite journal |last1=Berber |first1=Ahmet Ali |last2=Demi̇R |first2=Şefika Nur |last3=Akinci KenanoğLu |first3=Nihan |title=Potential Health Risks of Chloroacetanilide Herbicides: An In Silico Analysis |journal=Sakarya University Journal of Science |date=25 August 2023 |volume=27 |issue=4 |pages=865–871 |doi=10.16984/saufenbilder.1281720}}</ref> It was first reported in 1967 and introduced by Monsanto,<ref name="bcpce">{{cite book |last1=MacBean |first1=C. |title=A World Compendium: The Pesticide Manual |date=2012 |publisher=British Crop Production Council |location=Hampshire |isbn=978-1-901396-86-7 |edition=Sixteenth}}</ref> though by 1974 commercial factors had halted its commercialisation,<ref>BCPC, (1974) "[https://www.bcpc.org/wp-content/uploads/2022/07/BCPC-Weeds-Conference-1974-Vol-III-p1109-1197.pdf Proceedings 12th British Weed Control Conference]", accessed 22nd Feb 2026</ref> so delachlor is now considered obsolete,<ref name = "database"/> and appears never to have been registered in the USA.<ref>{{cite web |title=Delachlor |website=ordspub.epa.gov/ |url=https://ordspub.epa.gov/ords/pesticides/f?p=CHEMICALSEARCH:3::::1,3,31,7,12,25:P3_XCHEMICAL_ID:2047 |publisher=EPA Office of Pesticide Programs |access-date=16 March 2026}}</ref>
Delachlor's HRAC group is Group K (Australia), Group K3 (Global) and Group 15 (numeric).<ref name="database">{{cite web |last1=Hertfordshire |first1=University of |title=Delachlor (Ref: CP 52553), Pesticide Properties Database |url=https://sitem.herts.ac.uk/aeru/ppdb/en/Reports/2883.htm |website=sitem.herts.ac.uk}}</ref>
In artificial soil tests of phytotoxicity, with the herbicides cycloate, benzthiazuron and pyrazon. Delachlor was the most active in organic soils (>11% organics) though cycloate was more potent in other soils.<ref>{{cite journal |last1=Horowitz |first1=M. |last2=Blumenfeld |first2=T. |title=Phytotoxicity of four herbicides in different synthetic soils |journal=Phytoparasitica |date=December 1973 |volume=1 |issue=2 |pages=101–110 |doi=10.1007/BF02981039 |url=https://www.researchgate.net/publication/226149137_Phytotoxicity_of_four_herbicides_in_different_synthetic_soils}}</ref>
The LD<sub>50</sub> (by mouth) is reported to be 1775 mg/kg on an SDS,<ref name = "dutch sds"/> but 733 mg/kg on PPDB.<ref name = "database"/> The difference is similar to the difference between paracetamol and methanol.
It is soluble in chloroform and somewhat soluble in ethyl acetate.<ref name = "dutch sds"/>
==References== {{reflist}}
==External links== *{{PPDB|2883}}
{{aniline Herbicides}} {{herbicides}}
Category:Group 15 herbicides Category:Acetamides Category:Anilides Category:Isobutyl compounds Category:Anilide herbicides