{{chembox | ImageFile = Dehydroretinal.svg | ImageSize = 220 | ImageAlt = Skeletal formula of dehydroretinal | ImageFile1 = Dehydroretinal 3D ball.png | ImageSize1 = 240 | ImageAlt1 = Ball-and-stick model of the dehydroretinal molecule | IUPACName = 3,4-Didehydroretinal | SystematicName = (2''E'',4''E'',6''E'',8''E'')-3,7-Dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenal | OtherNames = 3,4-Dehydroretinal; 3,4-Didehydroretinaldehyde |Section1={{Chembox Identifiers | ChemSpiderID = 4444397 | InChI = 1/C20H26O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6-13,15H,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ | InChIKey = QHNVWXUULMZJKD-OVSJKPMPBA | StdInChI=1S/C20H26O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6-13,15H,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ | StdInChIKey = QHNVWXUULMZJKD-OVSJKPMPSA-N | CASNo=472-87-7 | PubChem=5280866 | KEGG = C05918 | 3DMet = B00875 | ChEBI = 28537 | EC_number = 207-457-7 | UNII = HV8T003XO1 | SMILES = O=C\C=C(\C=C\C=C(\C=C\C1=C(\C=C/CC1(C)C)C)C)C | MeSHName=Dehydroretinal }} |Section2={{Chembox Properties | C=20 | H=26 | O=1 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}
'''Dehydroretinal''' ('''3,4-dehydroretinal''') is a derivative metabolite of retinal<ref name="phn2012">{{Citation| editor1-first = Michael J. | editor1-last = Gibney| editor2-first = Barrie M.| editor2-last = Margetts| editor3-first = John M.| editor3-last = Kearney| editor4-first = Lenore| editor4-last = Arab| display-editors = 3| title = Public Health Nutrition| publisher = John Wiley & Sons|page = 210 |year = 2012|isbn = 978-1118574225 |url = https://books.google.com/books?id=WtRFYyts5IwC&pg=PA210}}</ref> belonging to the group of vitamin A<sub>2</sub> as a retinaldehyde form, besides the endogenously present 3,4-dehydroretinol and 3,4-dehydroretinoic acid.<ref name="Törmä H and Vahlquist A, 1985">{{cite journal |vauthors=Törmä H, Vahlquist A |title=Biosynthesis of 3-dehydroretinol (vitamin A2) from all-trans-retinol (vitamin A1) in human epidermis |journal= J. Invest. Dermatol. |volume= 85 |issue= 6 |pages=498–500 |year= 1985| pmid= 4067325 |doi=10.1111/1523-1747.ep12277290|doi-access= free }}</ref><ref name="Vahlquist A, 1980">{{cite journal |vauthors=Vahlquist A |title=The identification of dehydroretinol (vitamin A2) in human skin |journal= Experientia |volume= 36 |issue= 3 |pages=317–318 |year= 1980 |pmid=7371787 |doi=10.1007/bf01952299|s2cid=31357743 }}</ref>
The livers of some freshwater fishes and some fish found in India contain a higher ratio of dehydroretinal to retinal than do other species.<ref name="MortonRA, Stubbs AL, 1946">{{cite journal |vauthors=MortonRA, Stubbs AL |title= Ling cod and other fish liver oils rich in vitamin A2 |journal= Biochem J |volume= 40 |issue= 5–6 |pages=lix |year=1946| pmid= 20277273}}</ref><ref name="faoun1967">{{Citation| author = Food and Agriculture Organization of the United Nations| title = Requirements of Vitamin A, Thiamine, Riboflavin & Niacin: Report of a Joint Fao-Who Expert Group| publisher = United Nations|page = 26| year = 1967|isbn = 9251004536|url = https://books.google.com/books?id=mXHCL4M0FNMC&pg=PA26}}</ref>
==See also== * Retinene
==References== {{Reflist}}
Category:Vision Category:Signal transduction Category:Apocarotenoids Category:Photosynthetic pigments Category:Vitamins
{{photosynthesis-stub}} {{organic-compound-stub}}