{{short description|Organic compound (C10H20)}} {{Distinguish|Decane|Decyne}} {{Chembox | Watchedfields = changed | verifiedrevid = 443563584 | Name = Decene | ImageFile1 = 1-decene.svg | ImageFile2 = Dec-1-ene.svg | PIN = Dec-1-ene | OtherNames = Alpha Olefin C10; Decylene; α-Decene; 1-decene |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 12809 | InChI = 1/C10H20/c1-3-5-7-9-10-8-6-4-2/h3H,1,4-10H2,2H3 | InChIKey = AFFLGGQVNFXPEV-UHFFFAOYAO | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C10H20/c1-3-5-7-9-10-8-6-4-2/h3H,1,4-10H2,2H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = AFFLGGQVNFXPEV-UHFFFAOYSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 872-05-9 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 7O4U4C718P | PubChem = 13381 | EINECS = 212-819-2 | RTECS = HE2071401 | UNNumber = 3295, 1993 | ChEBI = 87315 | ChEMBL = 3187990 | SMILES = CCCCCCCCC=C }} |Section2={{Chembox Properties | C=10 | H=20 | Density = 0.74 g/cm<sup>3</sup><ref name=GESTIS>{{GESTIS|ZVG=493774}}</ref> | MeltingPtC = -66.3 | MeltingPt_ref = <ref name=GESTIS/> | BoilingPtC = 172 | BoilingPt_ref = <ref name=GESTIS/> }} |Section7={{Chembox Hazards | GHSPictograms = {{GHS02}}{{GHS08}}{{GHS09}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|226|304|410}} | PPhrases = {{P-phrases|210|233|240|241|242|243|273|280|301+310|303+361+353|331|370+378|391|403+235|405|501}} }} |Section8={{Chembox Related | OtherFunction_label = Alkenes | OtherFunction = Octene<br />Nonene<br />Undecene<br />Dodecene | OtherCompounds = Decane<br />Decanol }} }}

'''Decene''' {{IPAc-en|d|ɛ|k|iː|n}} is an organic compound with the chemical formula {{chem2|C10H20}}. Decene contains a chain of ten carbon atoms with one double bond, making it an alkene. There are many isomers of decene depending on the position and geometry of the double bond. Dec-1-ene is the only isomer of industrial importance. As an alpha olefin, it is used as a comonomer in copolymers and is an intermediate in the production of epoxides, amines, oxo alcohols, synthetic lubricants, synthetic fatty acids and alkylated aromatics.<ref>http://www.ineosoligomers.com/media/files/lao/LAO%20C10%20Data%20Sheet.pdf 1-Decene (Alpha Olefin C10)], ineosoligomers.com</ref>

The industrial processes used in the production of dec-1-ene are oligomerization of ethylene by the Ziegler process or by the cracking of petrochemical waxes.<ref>[http://www.inchem.org/documents/sids/sids/AOalfaolefins.pdf Alfa Olefins] {{Webarchive|url=https://web.archive.org/web/20170517120901/http://www.inchem.org/documents/sids/sids/AOalfaolefins.pdf |date=2017-05-17 }}, SIDS Initial Assessment Report</ref>

In ethenolysis, '''methyl oleate''', the ''methyl ester'' of oleic acid, converts to 1-decene and methyl 9-decenoate:<ref>{{ cite journal | last1 = Marinescu | first1 = Smaranda C. | last2 = Schrock | first2 = Richard R. | last3 = Müller | first3 = Peter | last4 = Hoveyda | first4 = Amir H. | title = Ethenolysis Reactions Catalyzed by Imido Alkylidene Monoaryloxide Monopyrrolide (MAP) Complexes of Molybdenum | journal = J. Am. Chem. Soc. | year = 2009 | volume = 131 | issue = 31 | pages = 10840–10841 | doi = 10.1021/ja904786y | pmid=19618951 | bibcode = 2009JAChS.13110840M }}</ref> ::<math chem>\overset{\text{methyl oleate}}{\ce{CH3(CH2)7CH=CH(CH2)7CO2Me}} + {\color{red}\ce{CH2=CH2}} \longrightarrow \overset{\text{1-decene}}{\ce{CH3(CH2)7CH=}{\color{red}\ce{CH2}}} + \overset{\text{9-decenoate}}{\ce{MeO2C(CH2)7CH=}{\color{red}\ce{CH2}}}</math>

Dec-1-ene has been isolated from the leaves and rhizome of the plant ''Farfugium japonicum'' and has been detected as the initial product in the microbial degradation of ''n''-decane.

==References== {{reflist}}

==External links== * {{Nist|id=C872059}}

{{Alkenes}}

{{Hydrides by group}}

Category:Alkenes