{{Chembox <!-- Images -->| Name = | ImageFile = Darobactin-Structure.png | ImageSize = 250px | ImageAlt = <!-- Names --> | IUPACName = <nowiki>(2S)-2-[[(2S)-2-[[(5R,17S,20S,26S,29S,30S)</nowiki>-17-amino-20-(2-amino-2-oxoethyl)-30-(3-aminopropyl)-26-(hydroxymethyl)-18,21,24,27-tetraoxo-6-oxa-2,13,19,22,25,28-hexazahexacyclo[29.3.1.0<sup>4,34</sup>.0<sup>5,23</sup>.0<sup>7,12</sup>.0<sup>11,15</sup>]pentatriaconta-1(34),3,7,9,11,14,31(35),32-octaene-29-carbonyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoic acid | OtherNames = <!-- Sections --> | SystematicName = | Section1 = {{Chembox Identifiers | CASNo = | PubChem = 154586077 | SMILES = NCCC[C@@H]1[C@H](NC(=O)[C@H](CO)NC(=O)[C@H]2NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CC3=CNC4=C3C=CC=C4O[C@@H]2C2=CNC3=CC=C1C=C23)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC1=CC=CC=C1)C(O)=O | StdInChI=1S/C47H55N11O12/c48-13-5-9-25-23-11-12-30-27(15-23)28(19-51-30)40-39(58-42(63)31(17-36(50)61)53-41(62)29(49)16-24-18-52-37-26(24)8-4-10-35(37)70-40)46(67)56-34(21-60)44(65)57-38(25)45(66)55-33(20-59)43(64)54-32(47(68)69)14-22-6-2-1-3-7-22/h1-4,6-8,10-12,15,18-19,25,29,31-34,38-40,51-52,59-60H,5,9,13-14,16-17,20-21,48-49H2,(H2,50,61)(H,53,62)(H,54,64)(H,55,66)(H,56,67)(H,57,65)(H,58,63)(H,68,69)/t25-,29-,31-,32-,33-,34-,38-,39-,40+/m0/s1 | StdInChIKey = IAOIRKWNLBCFFO-KUDSBEMESA-N }} | Section2 = {{Chembox Properties | C = 47 | H = 55 | N = 11 | O = 12 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} | Section4 = | Section5 = | Section6 = }} '''Darobactin''' is an experimental antibiotic compound that may be effective against Gram-negative bacteria. If it can be developed into a human-compatible form it would be the first to come from an animal microbiome.<ref name=":0">{{Cite web|url=https://www.sciencealert.com/a-new-antibiotic-has-been-found-inside-a-tiny-worm-that-could-save-us-from-superbugs|title=A Tiny Worm Has Been Found Carrying New Antibiotic That Could Help Us Fight Superbugs|last=Nield|first=David|date=24 November 2019|website=ScienceAlert|language=en-gb|url-status=live|archive-url=https://web.archive.org/web/20191125174542/https://www.sciencealert.com/a-new-antibiotic-has-been-found-inside-a-tiny-worm-that-could-save-us-from-superbugs |archive-date=2019-11-25 |access-date=2019-11-26}}</ref>

== History == The compound was discovered in ''Photorhabdus'' bacteria in 2019, living in the digestive systems of entomopathogenic nematodes.<ref name=":1">{{Cite journal|last1=Imai|first1=Yu|last2=Meyer|first2=Kirsten J.|last3=Iinishi|first3=Akira|last4=Favre-Godal|first4=Quentin|last5=Green|first5=Robert|last6=Manuse|first6=Sylvie|last7=Caboni|first7=Mariaelena|last8=Mori|first8=Miho|last9=Niles|first9=Samantha|last10=Ghiglieri|first10=Meghan|last11=Honrao|first11=Chandrashekhar|date=2019-11-20|title=A new antibiotic selectively kills Gram-negative pathogens|url= |journal=Nature|volume=576|issue=7787|language=en|pages=459–464|doi=10.1038/s41586-019-1791-1|pmid=31747680|issn=1476-4687|pmc=7188312|bibcode=2019Natur.576..459I}}</ref> Researchers identified the nematode as a possible host because they feed on insects by targeting their larvae and releasing bacteria that then confront pathogens similar to those found in humans.<ref name=":0" />

In experiments, it cured mice of infections with ''Escherichia coli'' and ''Klebsiella pneumoniae'', both members of the Enterobacteriaceae, without toxic side effects.<ref name=":0" />

== Gram-negative bacteria == Gram-negative bacteria have a characteristic architecture for the cell envelope, with an inner membrane, an outer membrane, and a periplasmic space in between. In this arrangement, the peptidoglycan layer is relatively thin and does not retain the crystal violet stain used in the Gram staining method of bacterial classification. Antibiotic resistance has become widespread in bacterial pathogens, and in Gram-negative bacteria such as the Enterobacteriaceae, much of this comes from acquired genes. The resistance genes encode proteins that export or inactivate β-lactam antibiotics, aminoglycosides, tetracycline, chloramphenicol, fosfomycin, etc. Plasmids carrying these genes readily move between strains or between species. Consequently, resistance to the currently available panel of approved antibiotics is an increasingly worrisome problem.<ref name=":0" /> The most recent class of antibiotics effective against these bacteria emerged in the 1960s.<ref name=":1" />

== Mode of action == Darobactin inhibits BamA and disrupts the proper formation of the Gram-negative cell envelope.<ref name=":1" /> BamA is a central component of the BamABCDE complex, which inserts proteins from the periplasm into the outer membrane. BamA also aids in the folding of outer membrane-bound proteins. Thus, darobactin prevents the proper formation of the outer membrane of bacteria, leading to cell death.<ref name=":0" /> Because only Gram-negative bacteria have BamA and outer membrane beta-barrel proteins, only they are susceptible to darobactin.

== Biosynthesis == Darobactin is a RiPP, that is, a ribosomally synthesized and post-translationally modified peptide. Its production and export is encoded by a typically silent five gene operon that showed minimal production under laboratory culture conditions. Mature darobactin consists of a seven amino acids core peptide derived from a longer precursor, with unusual Trp-1 to Trp-3 and Trp-3 to Lys-5 (or Arg-5, in variant forms) crosslinks.<ref name=":1" /> The key enzyme for maturation from the precursor to the mature form is the radical SAM/SPASM enzyme DarE.

== References == {{Reflist}}

Category:Polypeptide antibiotics Category:Heterocyclic compounds with 6 rings Category:Nitrogen heterocycles Category:Oxygen heterocycles