{{short description|Chemical compound}} {{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 447288226 | ImageFile=Desoxyadenosindiphosphat protoniert.svg | ImageSize=220 | ImageAlt = Skeletal formula of adenosine diphosphate | ImageFile1 = Deoxyadenosine-diphosphate-anion-3D-balls.png | ImageSize1 = 220 | ImageAlt1 = Ball-and-stick model of the adenosine diphosphate anion | IUPACName=2′-Deoxyadenosine 5′-(trihydrogen diphosphate) | SystematicName=[(2''R'',3''S'',5''R'')-5-(6-Amino-9''H''-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl trihydrogen diphosphate | OtherNames=dADP | Reference=<ref>[https://pubchem.ncbi.nlm.nih.gov/compound/620 dADP - Compound Summary], PubChem.</ref> |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo=2793-06-8 | UNII_Ref = {{fdacite|changed|FDA}} | UNII = APQ916I0QD | MeSHName=Deoxyadenosine+diphosphate | PubChem = 188966 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 164196 | SMILES = C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)O)O | InChI = 1/C10H15N5O9P2/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(23-7)2-22-26(20,21)24-25(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1 | InChIKey = DAEAPNUQQAICNR-RRKCRQDMBL | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C10H15N5O9P2/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(23-7)2-22-26(20,21)24-25(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = DAEAPNUQQAICNR-RRKCRQDMSA-N }} |Section2={{Chembox Properties | Formula=C<sub>10</sub>H<sub>15</sub>N<sub>5</sub>O<sub>9</sub>P<sub>2</sub> | MolarMass=411.201722 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }} '''Deoxyadenosine diphosphate''' is a nucleoside diphosphate. It is related to the common nucleic acid adenosine triphosphate (ATP), with the -OH (hydroxyl) group on the 2' carbon on the nucleotide's pentose removed (hence the deoxy- part of the name), and with one fewer phosphoryl group than ATP. This makes it also similar to adenosine diphosphate except with a hydroxyl group removed.
Deoxyadenosine diphosphate is abbreviated dADP.
==See also== *Cofactor *Guanosine *Cyclic adenosine monophosphate
==References== {{reflist}}
{{Nucleobases, nucleosides, and nucleotides}}
Category:Nucleotides Category:Pyrophosphate esters Category:Purines