{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 448828501 | IUPAC_name = (3''S'',5''S'',8''R'',10''S'',13''R'',14''S'',17''R'')-5,14-dihydroxy-3-((2''R'',4''S'',5''S'',6''R'')-5-hydroxy-4-methoxy-6-methyltetrahydro-2''H''-pyran-2-yloxy)-13-methyl-17-(5-oxo-2,5-dihydrofuran-3-yl)hexadecahydro-1''H''-cyclopenta[''a'']phenanthrene-10-carbaldehyde | image = Cymarine.png | image_class = skin-invert-image
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 508-77-0 | ATC_prefix = C01 | ATC_suffix = AC03 | PubChem = 441853 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 390429 | smiles = O=C\1OC/C(=C/1)[C@H]2CC[C@@]6(O)[C@]2(C)CC[C@H]4[C@H]6CC[C@]5(O)C[C@@H](O[C@@H]3O[C@@H]([C@@H](O)[C@@H](OC)C3)C)CC[C@]45C=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C30H44O9/c1-17-26(33)23(36-3)13-25(38-17)39-19-4-9-28(16-31)21-5-8-27(2)20(18-12-24(32)37-15-18)7-11-30(27,35)22(21)6-10-29(28,34)14-19/h12,16-17,19-23,25-26,33-35H,4-11,13-15H2,1-3H3/t17-,19+,20-,21+,22-,23+,25+,26-,27-,28+,29+,30+/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XQCGNURMLWFQJR-ZNDDOCHDSA-N | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = UK3LS8435E | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 1651908
<!--Chemical data--> | C=30 | H=44 | O=9 | synonyms = Cymarine; K-Strophanthin-α; NSC 7522; Strophantin K; WV 90043a; k-Strophanthin-α | melting_point = 148 }}
'''Cymarin''' (or '''cymarine''') is a cardiac glycoside. Plants of the genus ''Apocynum'', including ''Apocynum cannabinum'' and ''Apocynum venetum'', contain cymarin.<ref>{{cite book | title = Edible and Medicinal plants of the West | vauthors = Tilford GL | isbn = 0-87842-359-1}}</ref> Cymarin is a cardiac glycoside and an anti-arrhythmia and cardiotonic agent.<ref>{{PubChem|441853}}</ref>
==References== {{reflist}}
==External links== *{{Commonscatinline}}
{{Cardiac glycosides}}
Category:Cardenolides
{{cardiovascular-drug-stub}}