{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | drug_name = | image = Cycloproscaline.svg | image_class = skin-invert-image | width = | caption =
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = Oral<ref name="Trachsel_2013" /><ref name="Kolaczynska_2021" /> | class = Serotonin receptor modulator; Serotonin 5-HT<sub>2A</sub> receptor agonist; Serotonergic psychedelic; Hallucinogen | ATC_prefix = None | ATC_suffix =
<!-- Legal status --> | legal_status =
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = ≥6 hours<ref name="Trachsel_2013" /><ref name="Kolaczynska_2021" /> | excretion =
<!-- Identifiers --> | CAS_number = 2375260-81-2 | CAS_supplemental = | PubChem = 145874427 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 77003461 | UNII = | KEGG = | ChEBI = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms = CP; 4-Cyclopropoxy-3,5-dimethoxyphenethylamine; 4-cPrO-3,5-DMPEA
<!-- Chemical data --> | IUPAC_name = 2-(4-cyclopropyloxy-3,5-dimethoxyphenyl)ethanamine | C=13 | H=19 | N=1 | O=3 | SMILES = COC1=CC(=CC(=C1OC2CC2)OC)CCN | StdInChI = 1S/C13H19NO3/c1-15-11-7-9(5-6-14)8-12(16-2)13(11)17-10-3-4-10/h7-8,10H,3-6,14H2,1-2H3 | StdInChIKey = VRTSLAVKWTZKIT-UHFFFAOYSA-N }}
'''Cycloproscaline''' ('''CP'''), also known as '''4-cyclopropoxy-3,5-dimethoxyphenethylamine''' ('''4-cPrO-3,5-DMPEA'''), is a psychedelic drug of the phenethylamine and scaline families related to mescaline.<ref name="Trachsel_2013">{{cite book | vauthors = Trachsel D, Lehmann D, Enzensperger C | title = Phenethylamine: von der Struktur zur Funktion | location = Solothurn | pages = 706,713–716 | year = 2013 | trans-title = Phenethylamines: From Structure to Function | edition = 1 | publisher = Nachtschatten-Verlag | series = Nachtschatten-Science | isbn = 978-3-03788-700-4 | oclc = 858805226 | url = https://books.google.com/books?id=-Us1kgEACAAJ | language = de }}</ref><ref name="Kolaczynska_2021">{{cite journal | vauthors = Kolaczynska KE, Luethi D, Trachsel D, Hoener MC, Liechti ME | title = Receptor Interaction Profiles of 4-Alkoxy-3,5-Dimethoxy-Phenethylamines (Mescaline Derivatives) and Related Amphetamines | journal = Frontiers in Pharmacology | volume = 12 | article-number = 794254 | date = 2021 | pmid = 35222010 | pmc = 8865417 | doi = 10.3389/fphar.2021.794254 | doi-access = free }}</ref> It is the homologue of mescaline in which the 4-methoxy group has been replaced with a 4-cyclopropoxy group.<ref name="Trachsel_2013" /><ref name="Kolaczynska_2021" /> The drug has a dose of 60{{nbsp}}mg or more orally and a duration of 6{{nbsp}}hours or more, but has not been fully evaluated.<ref name="Trachsel_2013" /><ref name="Kolaczynska_2021" /> It is a low-potency full agonist of the serotonin 5-HT<sub>2A</sub> receptor and also interacts with other serotonin receptors such as the serotonin 5-HT<sub>1A</sub> and 5-HT<sub>2C</sub> receptors.<ref name="Kolaczynska_2021" /> The drug's chemical synthesis has been described.<ref name="Trachsel_2013" /> Cycloproscaline was first described in the scientific literature by Daniel Trachsel and colleagues in 2013.<ref name="Trachsel_2013" /> Its pharmacology was studied in greater detail in 2021.<ref name="Kolaczynska_2021" /> The drug is not a controlled substance in Canada as of 2025.<ref name="CDSA">{{cite web | title=Controlled Drugs and Substances Act | website=Department of Justice Canada | url=https://laws-lois.justice.gc.ca/eng/acts/c-38.8/FullText.html | access-date=19 January 2026}}</ref>
== See also == * Scaline * Cyclopropylmescaline
== References == {{Reflist}}
== External links == * [https://isomerdesign.com/pihkal/explore/10261 Cycloproscaline - Isomer Design]
{{Psychedelics}} {{Serotonin receptor modulators}} {{Phenethylamines}}
Category:5-HT2A agonists Category:Cyclopropyl compounds Category:Daniel Trachsel Category:Methoxy compounds Category:Psychedelic phenethylamines Category:Scalines
{{Hallucinogen-stub}}