{{Short description|Chemical compound}} {{Distinguish|Cyclexanone}} {{Drugbox | IUPAC_name = (''RS'')-2-(cyclopropylamino)-5-phenyl-1,3-oxazol-4-one | image = Cyclazodone structure.svg | image_class = skin-invert-image | width = 180px | chirality = Racemic mixture | drug_name = <!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = Legal | routes_of_administration = Oral
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 14461-91-7 | ATC_prefix = none | PubChem = 26701 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 2106536 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = O8U55ZRL9K | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 24875
<!--Chemical data--> | C=12 | H=12 | N=2 | O=2 | smiles = C1CC1NC2=NC(=O)C(O2)C3=CC=CC=C3 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C12H12N2O2/c15-11-10(8-4-2-1-3-5-8)16-12(14-11)13-9-6-7-9/h1-5,9-10H,6-7H2,(H,13,14,15) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = DNRKTAYPGADPGW-UHFFFAOYSA-N }}
'''Cyclazodone''' is a centrally acting stimulant drug developed by American Cyanamid Company in the 1960s.<ref>{{cite patent | country = US | number = 3321470 | title = 5-Arylidene-2-Amino-2-Oxazolin-4-Ones | assign1 = American Cyanamid | inventor = Howell Jr CF, Hardy RA, Quinones N | gdate = 23 May 1967 }}</ref> The drug is related to other drugs such as pemoline and thozalinone. It displayed a favorable therapeutic index and margin of safety in comparison to most other pemoline derivatives.<ref name = "US3609159">{{cite patent | country = US | number = 3609159 | title = 5-Phenyl-2-Cyclopropylamino-4-Oxazolinone | inventor = De Marne V, Pierre D, Guidicelli RL, Najer H | assign1 = Les Laboratoires Dausse | gdate = 28 September 1971 }}</ref> The patents concluded that cyclazodone possessed properties efficacious in reducing fatigue and as a potential anorectic.<ref>{{cite patent | country = GB | number = 1005738 | title = 5-Phenyl-2-Cyclopropylamino-4-Oxazolinone | inventor = De Marne V, Pierre D, Guidicelli RL, Najer H | assign1 = Les Laboratoires Dausse | gdate = 29 September 1965 }}</ref> Structural congeners of pemoline have been described as "excitants with unique properties distinguishing them from the sympathomimetic amines" whilst displaying less stimulatory activity and toxicity compared to amphetamine.<ref name="pmid4378772">{{cite journal | vauthors = Greenblatt EN, Osterberg AC | title = Some pharmacologic properties of thozalinone, a new excitant | journal = Toxicology and Applied Pharmacology | volume = 7 | issue = 4 | pages = 566–78 | date = July 1965 | pmid = 4378772 | doi = 10.1016/0041-008x(65)90042-6 }}</ref>
It is included under the World Anti-Doping Agency prohibited list.<ref>{{cite web | url = https://www.wada-ama.org/sites/default/files/resources/files/WADA_Prohibited_List_2008_EN.pdf | title = World Anti-Doping Agency 2008 Prohibited List | date = 22 September 2007 | work = World Anti-Doping Agency }}</ref>
==Safety== Cyclazodone has not been evaluated by the United States Food and Drug Administration for use in humans as a nootropic, anorectic, or stimulant and thus safety information is lacking. However, in studies relating to the therapeutic uses of cyclazodone, it was noted that it exhibited less cardiotoxic effects than dextroamphetamine in studies on mice.<ref name = "US3609159" /> ==Synthesis== :class=skin-invert-image|upright=2 α-Chlorophenylacetyl chloride (1) and N-cyclopropylurea (2) react to give the diketone (3). Ring closure with sodium ethoxide in ethanol completes the synthesis.<ref name = "US3609159"/><ref>Najer, H. et al, Bull. Soc. Chim. Fr., 1963, 1810.</ref>
==See also== *Fenozolone *Amiphenazole * List of aminorex analogues
==References== {{Reflist}}
{{Stimulants}} {{Monoamine releasing agents}}
Category:Stimulants Category:Aminorexes Category:Norepinephrine-dopamine releasing agents Category:Oxazolones
{{nervous-system-drug-stub}}