{{Chembox | ImageFile = Cyamelide.svg | ImageSize = 150px | ImageAlt = | IUPACName = 1,3,5-Trioxane-2,4,6-triimine | OtherNames = Cyamelide, insoluble cyanuric acid |Section1={{Chembox Identifiers | CASNo = 462-02-2 | PubChem = 12305305 | ChemSpiderID = 10468516 | UNII = AJA92R648N | ChEBI = 38042 | Gmelin = 240323 | StdInChI=1S/C3H3N3O3/c4-1-7-2(5)9-3(6)8-1/h4-6H | StdInChIKey = SMEDVXJKKOXLCP-UHFFFAOYSA-N | SMILES = C1(=N)OC(=N)OC(=N)O1 }} |Section2={{Chembox Properties | C=3 | H=3 | N=3 | O=3 | Appearance = White solid | Density = 2.08 g/cm<sup>3</sup> | MeltingPt = | BoilingPt = | Solubility = Low}} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Cyamelide''' is an amorphous white solid with the approximate formula (HNCO)<sub>x</sub>. It is the product of the polymerisation of cyanic acid together with its cyclic trimer cyanuric acid. It is a porcelain-like white substance which is insoluble in water.

== References ==

*{{cite journal | title = Synthesis, Properties and Dimerization Study of Isocyanic Acid |author1=G. Fischer |author2=J. Geith |author3=T. M. Klapötke |author4=B. Krumm | journal = Z. Naturforsch. | year = 2002 | volume = 57b | issue = 1 | pages = 19–25 |doi=10.1515/znb-2002-0103 | url = http://www.znaturforsch.com/ab/v57b/s57b0019.pdf }} *{{cite journal | title = Concerning cyamelide | author = Hantzsch A | journal = Berichte der Deutschen Chemischen Gesellschaft | year = 1905 | volume = | issue = | pages = 1013–1021 }}

Category:Polyamides