{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 440124884 | Name = Coutaric acid | ImageFile = Coutaric acid.svg | ImageSize = 200px | ImageName = Chemical structure of coutaric acid | ImageAlt = Chemical structure of coutaric acid | PIN = (2''R'',3''R'')-2-Hydroxy-3-<nowiki/>{[(2''E'')-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}butanedioic acid | OtherNames = trans-coutaric acid<br>cis-coutaric acid<br>''trans''-''p''-Coumaroyltartaric acid<br>cis-p-coumaroyl-(+)-tartaric acid<br>trans-p-coumaroyl-(+)-tartaric acid<br>cis-Coumaroyl tartaric acidbr>trans-Coumaroyl tartaric acid |Section1={{Chembox Identifiers | CASNo = 27174-07-8 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = K874CF6AHR | CASNo_Ref = {{cascite|correct|CAS}} | CASNoOther = | PubChem = 57517924 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 26325199 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 77439 | SMILES = c1cc(ccc1/C=C/C(=O)O[C@H]([C@H](C(=O)O)O)C(=O)O)O | InChI = 1/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20)/b6-3+/t10-,11-/m1/s1 | InChIKey = INYJZRKTYXTZHP-NNPIPJJVBX | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20)/b6-3+/t10-,11-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = INYJZRKTYXTZHP-NNPIPJJVSA-N | MeSHName = }} |Section2={{Chembox Properties | C=13 | H=12 | O=8 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Coutaric acid''' is a hydroxycinnamoyltartaric acid found in wine, pomace<ref>{{Cite journal | last1 = Maier | first1 = T. | last2 = Sanzenbacher | first2 = S. | last3 = Kammerer | first3 = D. R. | last4 = Berardini | first4 = N. | last5 = Conrad | first5 = J. R. | last6 = Beifuss | first6 = U. | last7 = Carle | first7 = R. | last8 = Schieber | first8 = A. | doi = 10.1016/j.chroma.2006.06.082 | title = Isolation of hydroxycinnamoyltartaric acids from grape pomace by high-speed counter-current chromatography | journal = Journal of Chromatography A | volume = 1128 | issue = 1–2 | pages = 61–67 | year = 2006 | pmid = 16860334}}</ref> and grape.<ref>{{Cite journal | last1 = Singleton | first1 = V. L. | last2 = Zaya | first2 = J. | last3 = Trousdale | first3 = E. K. | doi = 10.1016/0031-9422(86)80078-4 | title = Caftaric and coutaric acids in fruit of Vitis | journal = Phytochemistry | volume = 25 | issue = 9 | pages = 2127 | year = 1986 }}</ref> It is an ester formed from coumaric acid and tartaric acid.

<!-- ==Metabolism== -->

== References == {{reflist}}

{{Hydroxycinnamic acid}}

Category:Hydroxycinnamic acid esters

{{aromatic-stub}}